Difference between revisions of "CPD-18118"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18390 CPD-18390] == * smiles: ** CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])[O-])OC(CCCCCCCCCCCCC...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18118 CPD-18118] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * common name: ** D-...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18118 CPD-18118] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** D-arabinofuranose 5-phosphate |
+ | * inchi key: | ||
+ | ** InChIKey=KTVPXOYAKDPRHY-ZRMNMSDTSA-L | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 228.095 |
* Synonym(s): | * Synonym(s): | ||
+ | ** D-arabinofuranose 5P | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[KDO-8PSYNTH-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91825727 91825727] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=85971 85971] |
− | {{#set: smiles= | + | {{#set: smiles=C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)}} |
− | {{#set: | + | {{#set: common name=D-arabinofuranose 5-phosphate}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=KTVPXOYAKDPRHY-ZRMNMSDTSA-L}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=228.095 }} |
− | {{#set: | + | {{#set: common name=D-arabinofuranose 5P}} |
+ | {{#set: consumed by=KDO-8PSYNTH-RXN}} |
Latest revision as of 20:44, 21 March 2018
Contents
Metabolite CPD-18118
- smiles:
- C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)
- common name:
- D-arabinofuranose 5-phosphate
- inchi key:
- InChIKey=KTVPXOYAKDPRHY-ZRMNMSDTSA-L
- molecular weight:
- 228.095
- Synonym(s):
- D-arabinofuranose 5P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)" cannot be used as a page name in this wiki.