Difference between revisions of "Tiso gene 15500"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12905 CPD-12905] == * smiles: ** CC(C)=CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...")
(Created page with "Category:Gene == Gene Tiso_gene_15500 == * Synonym(s): == Reactions associated == * Reaction: RXN0-5462 ** Source: orthology-esiliculosus == Pathways associated =...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12905 CPD-12905] ==
+
== Gene Tiso_gene_15500 ==
* smiles:
+
** CC(C)=CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=OLZYNLSKRKFUJC-FPVIQYCMSA-J
+
* common name:
+
** 3-hydroxy-5-methylhex-4-enoyl-CoA
+
* molecular weight:
+
** 889.657   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN0-5462]]
* [[RXN-11919]]
+
** Source: [[orthology-esiliculosus]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=RXN0-5462}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986102 50986102]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C16469 C16469]
+
* HMDB : HMDB60373
+
{{#set: smiles=CC(C)=CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=OLZYNLSKRKFUJC-FPVIQYCMSA-J}}
+
{{#set: common name=3-hydroxy-5-methylhex-4-enoyl-CoA}}
+
{{#set: molecular weight=889.657    }}
+
{{#set: produced by=RXN-11919}}
+

Latest revision as of 19:54, 21 March 2018

Gene Tiso_gene_15500

  • Synonym(s):

Reactions associated

Pathways associated

External links