Difference between revisions of "Glutamine-synthetase-Tyr"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15677 CPD-15677] == * smiles: ** CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glutamine-synthetase-Tyr Glutamine-synthetase-Tyr] == * common name: ** a [glutamine-synthetase...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15677 CPD-15677] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glutamine-synthetase-Tyr Glutamine-synthetase-Tyr] ==
* smiles:
+
** CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=AFMMIIQKXQNEDN-DUPKWVSKSA-J
+
 
* common name:
 
* common name:
** 4-trans-undecenoyl-CoA
+
** a [glutamine-synthetase]-L-tyrosine
* molecular weight:
+
** 929.765   
+
 
* Synonym(s):
 
* Synonym(s):
** 4E-undecenoyl-CoA
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14789]]
+
* [[GSADENYLATION-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14788]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a [glutamine-synthetase]-L-tyrosine}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658640 90658640]
+
{{#set: consumed by=GSADENYLATION-RXN}}
{{#set: smiles=CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=AFMMIIQKXQNEDN-DUPKWVSKSA-J}}
+
{{#set: common name=4-trans-undecenoyl-CoA}}
+
{{#set: molecular weight=929.765    }}
+
{{#set: common name=4E-undecenoyl-CoA}}
+
{{#set: consumed by=RXN-14789}}
+
{{#set: produced by=RXN-14788}}
+

Latest revision as of 19:54, 21 March 2018

Metabolite Glutamine-synthetase-Tyr

  • common name:
    • a [glutamine-synthetase]-L-tyrosine
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [glutamine-synthetase]-L-tyrosine" cannot be used as a page name in this wiki.