Difference between revisions of "CPD-2742"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACCOAtm ACCOAtm] == * direction: ** REVERSIBLE * common name: ** Acetyl-CoA:CoA antiporter, mitocho...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2742 CPD-2742] == * smiles: ** C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2)) * common name: ** cotinin...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2742 CPD-2742] == |
| − | * | + | * smiles: |
| − | ** | + | ** C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2)) |
* common name: | * common name: | ||
| − | ** | + | ** cotinine |
| + | * inchi key: | ||
| + | ** InChIKey=UIKROCXWUNQSPJ-VIFPVBQESA-N | ||
| + | * molecular weight: | ||
| + | ** 176.218 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN66-169]] |
| − | + | * [[RXN66-161]] | |
| − | * | + | * [[RXN66-168]] |
| − | + | * [[RXN66-163]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | == | + | |
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=854019 854019] | |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.746405.html 746405] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=68641 68641] |
| − | {{#set: | + | * METABOLIGHTS : MTBLC68641 |
| + | * HMDB : HMDB01046 | ||
| + | {{#set: smiles=C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2))}} | ||
| + | {{#set: common name=cotinine}} | ||
| + | {{#set: inchi key=InChIKey=UIKROCXWUNQSPJ-VIFPVBQESA-N}} | ||
| + | {{#set: molecular weight=176.218 }} | ||
| + | {{#set: consumed by=RXN66-169|RXN66-161|RXN66-168|RXN66-163}} | ||
Latest revision as of 19:58, 21 March 2018
Contents
Metabolite CPD-2742
- smiles:
- C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2))
- common name:
- cotinine
- inchi key:
- InChIKey=UIKROCXWUNQSPJ-VIFPVBQESA-N
- molecular weight:
- 176.218
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2))" cannot be used as a page name in this wiki.
