Difference between revisions of "CPD-3187"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLUCARATE D-GLUCARATE] == * smiles: ** C(=O)(C(O)C(O)C(O)C(O)C(=O)[O-])[O-] * inchi key: ** I...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] == * smiles: ** C1(CCC(O)([N+](C)1)C2(=CN=CC=C2)) * common name: ** 2'-hydro...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C1(CCC(O)([N+](C)1)C2(=CN=CC=C2)) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 2'-hydroxynicotine |
| + | * inchi key: | ||
| + | ** InChIKey=BOQRPPFUUSHFGW-SNVBAGLBSA-O | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 179.241 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN66-146]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245599 25245599] |
| − | * HMDB : | + | * HMDB : HMDB01329 |
| − | + | {{#set: smiles=C1(CCC(O)([N+](C)1)C2(=CN=CC=C2))}} | |
| − | + | {{#set: common name=2'-hydroxynicotine}} | |
| − | + | {{#set: inchi key=InChIKey=BOQRPPFUUSHFGW-SNVBAGLBSA-O}} | |
| − | + | {{#set: molecular weight=179.241 }} | |
| − | + | {{#set: produced by=RXN66-146}} | |
| − | + | ||
| − | + | ||
| − | {{#set: smiles= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: molecular weight= | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 19:59, 21 March 2018
Contents
Metabolite CPD-3187
- smiles:
- C1(CCC(O)([N+](C)1)C2(=CN=CC=C2))
- common name:
- 2'-hydroxynicotine
- inchi key:
- InChIKey=BOQRPPFUUSHFGW-SNVBAGLBSA-O
- molecular weight:
- 179.241
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB01329
"C1(CCC(O)([N+](C)1)C2(=CN=CC=C2))" cannot be used as a page name in this wiki.
