Difference between revisions of "Tiso gene 9068"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-718 CPD-718] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(=O)CCC...")
(Created page with "Category:Gene == Gene Tiso_gene_9068 == * right end position: ** 6140 * transcription direction: ** POSITIVE * left end position: ** 105 * centisome position: ** 1.0901163...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-718 CPD-718] ==
+
== Gene Tiso_gene_9068 ==
−
* smiles:
+
* right end position:
−
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** 6140
−
* inchi key:
+
* transcription direction:
−
** InChIKey=SVBMASFUJDIDJC-XFJIFGBKSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 3-dehydroteasterone
+
** 105
−
* molecular weight:
+
* centisome position:
−
** 446.669    
+
** 1.0901163    
 
* Synonym(s):
 
* Synonym(s):
−
** dehydroteasterone
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3.2.2.23-RXN]]
−
* [[RXN-717]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=6140}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14353979 14353979]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=105}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20000 20000]
+
{{#set: centisome position=1.0901163   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=3.2.2.23-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15792 C15792]
+
−
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
−
{{#set: inchi key=InChIKey=SVBMASFUJDIDJC-XFJIFGBKSA-N}}
+
−
{{#set: common name=3-dehydroteasterone}}
+
−
{{#set: molecular weight=446.669   }}
+
−
{{#set: common name=dehydroteasterone}}
+
−
{{#set: produced by=RXN-717}}
+

Latest revision as of 19:59, 21 March 2018

Gene Tiso_gene_9068

  • right end position:
    • 6140
  • transcription direction:
    • POSITIVE
  • left end position:
    • 105
  • centisome position:
    • 1.0901163
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_9068&oldid=45134"