|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DNA-DIRECTED-DNA-POLYMERASE-RXN DNA-DIRECTED-DNA-POLYMERASE-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIAMINONONANOATE DIAMINONONANOATE] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** CC(C(CCCCCC([O-])=O)[N+])[N+] |
| * common name: | | * common name: |
− | ** translesion_dna_polymerase-rev1_deoxycytidyl_transferase | + | ** 7,8-diaminopelargonate |
− | ** wd_repeat_domain-containing_protein | + | * inchi key: |
− | ** glucose-6-phosphate_phosphate_and_phosphoenolpyruvate_phosphate_antiporter | + | ** InChIKey=KCEGBPIYGIWCDH-UHFFFAOYSA-O |
− | ** dna_polymerase | + | * molecular weight: |
− | ** nucleotidyltransferase_domain_containing_protein
| + | ** 189.277 |
− | ** dna_polymerase_eta
| + | |
− | ** dna_polymerase_epsilon_subunit_b_protein
| + | |
− | ** dna_polymerase_epsilon_subunit_b-like_protein
| + | |
− | ** dna_polymerase_alpha_subunit_two
| + | |
− | ** dna_polymerase_i
| + | |
− | ** dna_repair_deoxycytidyl_transferase_rev1
| + | |
− | ** dna_polymerase_delta_subunit_4
| + | |
− | ** drug_metabolite_transporter_superfamily
| + | |
− | ** dna_polymerase_zeta_catalytic_subunit
| + | |
− | * ec number:
| + | |
− | ** [http://enzyme.expasy.org/EC/2.7.7.7 EC-2.7.7.7] | + | |
| * Synonym(s): | | * Synonym(s): |
| + | ** 7,8-diaminononanoate |
| + | ** DAPA |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[DETHIOBIOTIN-SYN-RXN]] |
− | ** 1 [[Deoxy-Ribonucleoside-Triphosphates]][c] '''+''' 1 [[DNA-N]][c] '''=>''' 1 [[DNA-N]][c] '''+''' 1 [[PPI]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 a 2'-deoxyribonucleoside 5'-triphosphate[c] '''+''' 1 DNAn[c] '''=>''' 1 DNAn[c] '''+''' 1 diphosphate[c]
| + | * [[DAPASYN-RXN]] |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_8127]] | + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_11577]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | * [[Tiso_gene_6588]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_865]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_4873]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_4276]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_16689]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_18790]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_6214]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_11822]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_5184]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_13303]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_8058]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_3651]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_7195]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_17661]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_7025]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_10530]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_11013]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_1474]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_866]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_17523]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_12155]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_11334]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_17660]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | == Pathways == | + | |
− | == Reconstruction information == | + | |
− | * Category: [[orthology]] | + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * LIGAND-RXN: | + | * PUBCHEM: |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00379 R00379] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245451 25245451] |
− | * UNIPROT:
| + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/P06856 P06856]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58500 58500] |
− | ** [http://www.uniprot.org/uniprot/P06766 P06766]
| + | * BIGG : dann |
− | ** [http://www.uniprot.org/uniprot/P15801 P15801] | + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/P59200 P59200] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01037 C01037] |
− | ** [http://www.uniprot.org/uniprot/P19821 P19821]
| + | {{#set: smiles=CC(C(CCCCCC([O-])=O)[N+])[N+]}} |
− | ** [http://www.uniprot.org/uniprot/P14284 P14284]
| + | {{#set: common name=7,8-diaminopelargonate}} |
− | ** [http://www.uniprot.org/uniprot/P21951 P21951] | + | {{#set: inchi key=InChIKey=KCEGBPIYGIWCDH-UHFFFAOYSA-O}} |
− | ** [http://www.uniprot.org/uniprot/P28339 P28339] | + | {{#set: molecular weight=189.277 }} |
− | ** [http://www.uniprot.org/uniprot/P52027 P52027] | + | {{#set: common name=7,8-diaminononanoate|DAPA}} |
− | ** [http://www.uniprot.org/uniprot/P28340 P28340]
| + | {{#set: consumed by=DETHIOBIOTIN-SYN-RXN}} |
− | ** [http://www.uniprot.org/uniprot/P30321 P30321]
| + | {{#set: reversible reaction associated=DAPASYN-RXN}} |
− | ** [http://www.uniprot.org/uniprot/P28630 P28630]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28905 P28905]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q36586 Q36586]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28632 P28632]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q23687 Q23687]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59690 Q59690]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43744 P43744]
| + | |
− | ** [http://www.uniprot.org/uniprot/O28552 O28552]
| + | |
− | ** [http://www.uniprot.org/uniprot/O57863 O57863]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PPI9 Q9PPI9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JW44 Q9JW44]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JVX8 Q9JVX8]
| + | |
− | ** [http://www.uniprot.org/uniprot/P05649 P05649]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27903 P27903]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33611 P33611]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59691 Q59691]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43745 P43745]
| + | |
− | ** [http://www.uniprot.org/uniprot/O27456 O27456]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9CJJ1 Q9CJJ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JV62 Q9JV62]
| + | |
− | ** [http://www.uniprot.org/uniprot/P47659 P47659]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59024 Q59024]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JTS1 Q9JTS1]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06538 P06538]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04495 P04495]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09854 P09854]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07918 P07918]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09252 P09252]
| + | |
− | ** [http://www.uniprot.org/uniprot/P03198 P03198]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28857 P28857]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07917 P07917]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08546 P08546]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28858 P28858]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04293 P04293]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28859 P28859]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04292 P04292]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27172 P27172]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10479 P10479]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06225 P06225]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04415 P04415]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19822 P19822]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00581 P00581]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10443 P10443]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A988 P0A988]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06710 P06710]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00582 P00582]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09884 P09884]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18131 P18131]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A121 P0A121]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20509 P20509]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q91EK5 Q91EK5]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28040 P28040]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43741 P43741]
| + | |
− | ** [http://www.uniprot.org/uniprot/O28484 O28484]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33761 P33761]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9V2F4 Q9V2F4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PJA9 Q9PJA9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JTI9 Q9JTI9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JTM2 Q9JTM2]
| + | |
− | ** [http://www.uniprot.org/uniprot/P03680 P03680]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06950 P06950]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43746 P43746]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q58113 Q58113]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13267 P13267]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q50790 Q50790]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9V2F3 Q9V2F3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PIG2 Q9PIG2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JWB1 Q9JWB1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9CDS1 Q9CDS1]
| + | |
− | ** [http://www.uniprot.org/uniprot/P54098 P54098]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PND8 Q9PND8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PI56 Q9PI56]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9CIG3 Q9CIG3]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43743 P43743]
| + | |
− | ** [http://www.uniprot.org/uniprot/O27579 O27579]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JVB2 Q9JVB2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9CI70 Q9CI70]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49005 P49005]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q08880 Q08880]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49004 P49004]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q62085 Q62085]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43749 P43749]
| + | |
− | ** [http://www.uniprot.org/uniprot/P03007 P03007]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29439 P29439]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30314 P30314]
| + | |
− | ** [http://www.uniprot.org/uniprot/P95690 P95690]
| + | |
− | ** [http://www.uniprot.org/uniprot/O00874 O00874]
| + | |
− | ** [http://www.uniprot.org/uniprot/O50607 O50607]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9P9N2 Q9P9N2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9P9N1 Q9P9N1]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21189 P21189]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12899 P12899]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11292 P11292]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12898 P12898]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24024 P24024]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17192 P17192]
| + | |
− | ** [http://www.uniprot.org/uniprot/P03160 P03160]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06275 P06275]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12900 P12900]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q66400 Q66400]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13846 P13846]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17394 P17394]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17395 P17395]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17393 P17393]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17100 P17100]
| + | |
− | ** [http://www.uniprot.org/uniprot/P03161 P03161]
| + | |
− | ** [http://www.uniprot.org/uniprot/P03156 P03156]
| + | |
− | ** [http://www.uniprot.org/uniprot/P03159 P03159]
| + | |
− | ** [http://www.uniprot.org/uniprot/P03155 P03155]
| + | |
− | ** [http://www.uniprot.org/uniprot/P03157 P03157]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31870 P31870]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30028 P30028]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17396 P17396]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17193 P17193]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24117 P24117]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19894 P19894]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22838 P22838]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21174 P21174]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30318 P30318]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q05486 Q05486]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q04957 Q04957]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01843 Q01843]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WT26 Q9WT26]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15436 P15436]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9XMH7 Q9XMH7]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22374 P22374]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M007 Q7M007]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20311 P20311]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09122 P09122]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30316 P30316]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27727 P27727]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q67878 Q67878]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q67882 Q67882]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q95037 Q95037]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30315 P30315]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24701 P24701]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26811 P26811]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30319 P30319]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33537 P33537]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26019 P26019]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30322 P30322]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q05254 Q05254]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q07635 Q07635]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0ABS8 P0ABS8]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28631 P28631]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q81107 Q81107]
| + | |
− | ** [http://www.uniprot.org/uniprot/P61875 P61875]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34029 P34029]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43139 P43139]
| + | |
− | ** [http://www.uniprot.org/uniprot/P52431 P52431]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q35599 Q35599]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30317 P30317]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q67952 Q67952]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q52851 Q52851]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27344 P27344]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33609 P33609]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q67892 Q67892]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06746 P06746]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q37971 Q37971]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q38136 Q38136]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A024 P0A024]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46957 P46957]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13382 P13382]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24482 P24482]
| + | |
− | ** [http://www.uniprot.org/uniprot/O03684 O03684]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q50313 Q50313]
| + | |
− | ** [http://www.uniprot.org/uniprot/P87744 P87744]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q56366 Q56366]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q51334 Q51334]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9YKD1 Q9YKD1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WNS2 Q9WNS2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QAG0 Q9QAG0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QAF7 Q9QAF7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QAF6 Q9QAF6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QAF3 Q9QAF3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IF40 Q9IF40]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q96846 Q96846]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q67919 Q67919]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q67913 Q67913]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q67874 Q67874]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QXQ1 Q8QXQ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QXP7 Q8QXP7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JN15 Q8JN15]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JN11 Q8JN11]
| + | |
− | ** [http://www.uniprot.org/uniprot/O56655 O56655]
| + | |
− | ** [http://www.uniprot.org/uniprot/O56654 O56654]
| + | |
− | ** [http://www.uniprot.org/uniprot/O11885 O11885]
| + | |
− | ** [http://www.uniprot.org/uniprot/P72856 P72856]
| + | |
− | ** [http://www.uniprot.org/uniprot/P95979 P95979]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q55971 Q55971]
| + | |
− | ** [http://www.uniprot.org/uniprot/P73507 P73507]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46835 P46835]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q49008 Q49008]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q49056 Q49056]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q49086 Q49086]
| + | |
− | ** [http://www.uniprot.org/uniprot/O36363 O36363]
| + | |
− | ** [http://www.uniprot.org/uniprot/O68045 O68045]
| + | |
− | ** [http://www.uniprot.org/uniprot/O48901 O48901]
| + | |
− | ** [http://www.uniprot.org/uniprot/P47658 P47658]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46387 P46387]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q83948 Q83948]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9YZU3 Q9YZU3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9YZS3 Q9YZS3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q27607 Q27607]
| + | |
− | ** [http://www.uniprot.org/uniprot/O18475 O18475]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q61493 Q61493]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q94636 Q94636]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q27152 Q27152]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9YW56 Q9YW56]
| + | |
− | ** [http://www.uniprot.org/uniprot/O21376 O21376]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33793 P33793]
| + | |
− | ** [http://www.uniprot.org/uniprot/O44055 O44055]
| + | |
− | ** [http://www.uniprot.org/uniprot/O54376 O54376]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98207 Q98207]
| + | |
− | ** [http://www.uniprot.org/uniprot/O57191 O57191]
| + | |
− | ** [http://www.uniprot.org/uniprot/O31096 O31096]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Z618 Q9Z618]
| + | |
− | ** [http://www.uniprot.org/uniprot/O59835 O59835]
| + | |
− | ** [http://www.uniprot.org/uniprot/O39272 O39272]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9YTQ4 Q9YTQ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/P81412 P81412]
| + | |
− | ** [http://www.uniprot.org/uniprot/P81409 P81409]
| + | |
− | ** [http://www.uniprot.org/uniprot/P03261 P03261]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: common name=translesion_dna_polymerase-rev1_deoxycytidyl_transferase}}
| + | |
− | {{#set: common name=wd_repeat_domain-containing_protein}} | + | |
− | {{#set: common name=glucose-6-phosphate_phosphate_and_phosphoenolpyruvate_phosphate_antiporter}} | + | |
− | {{#set: common name=dna_polymerase}} | + | |
− | {{#set: common name=nucleotidyltransferase_domain_containing_protein}} | + | |
− | {{#set: common name=dna_polymerase_eta}}
| + | |
− | {{#set: common name=dna_polymerase_epsilon_subunit_b_protein}}
| + | |
− | {{#set: common name=dna_polymerase_epsilon_subunit_b-like_protein}}
| + | |
− | {{#set: common name=dna_polymerase_alpha_subunit_two}} | + | |
− | {{#set: common name=dna_polymerase_i}}
| + | |
− | {{#set: common name=dna_repair_deoxycytidyl_transferase_rev1}}
| + | |
− | {{#set: common name=dna_polymerase_delta_subunit_4}}
| + | |
− | {{#set: common name=drug_metabolite_transporter_superfamily}}
| + | |
− | {{#set: common name=dna_polymerase_zeta_catalytic_subunit}}
| + | |
− | {{#set: ec number=EC-2.7.7.7}}
| + | |
− | {{#set: gene associated=Tiso_gene_8127|Tiso_gene_11577|Tiso_gene_6588|Tiso_gene_865|Tiso_gene_4873|Tiso_gene_4276|Tiso_gene_16689|Tiso_gene_18790|Tiso_gene_6214|Tiso_gene_11822|Tiso_gene_5184|Tiso_gene_13303|Tiso_gene_8058|Tiso_gene_3651|Tiso_gene_7195|Tiso_gene_17661|Tiso_gene_7025|Tiso_gene_10530|Tiso_gene_11013|Tiso_gene_1474|Tiso_gene_866|Tiso_gene_17523|Tiso_gene_12155|Tiso_gene_11334|Tiso_gene_17660}} | + | |
− | {{#set: in pathway=}}
| + | |
− | {{#set: reconstruction category=orthology|annotation}}
| + | |
− | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}}
| + | |
− | {{#set: reconstruction tool=pantograph|pathwaytools}}
| + | |