Difference between revisions of "SECOLOGANIN-CPD"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14725 RXN-14725] == * direction: ** LEFT-TO-RIGHT * common name: ** probable_nitrile_hydratase...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SECOLOGANIN-CPD SECOLOGANIN-CPD] == * smiles: ** C=C[CH]1(C(OC=C(C(=O)OC)[CH](CC=O)1)OC2(OC(CO)...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SECOLOGANIN-CPD SECOLOGANIN-CPD] == |
| − | * | + | * smiles: |
| − | ** | + | ** C=C[CH]1(C(OC=C(C(=O)OC)[CH](CC=O)1)OC2(OC(CO)C(O)C(O)C(O)2)) |
* common name: | * common name: | ||
| − | ** | + | ** secologanin |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=CSKKDSFETGLMSB-NRZPKYKESA-N |
| + | * molecular weight: | ||
| + | ** 388.371 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** (-)-secologanin | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | * [[STRICTOSIDINE-SYNTHASE-RXN]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * LIPID_MAPS : LMPR0102070002 | |
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=161276 161276] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.141670.html 141670] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18002 18002] |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01852 C01852] | ||
| + | {{#set: smiles=C=C[CH]1(C(OC=C(C(=O)OC)[CH](CC=O)1)OC2(OC(CO)C(O)C(O)C(O)2))}} | ||
| + | {{#set: common name=secologanin}} | ||
| + | {{#set: inchi key=InChIKey=CSKKDSFETGLMSB-NRZPKYKESA-N}} | ||
| + | {{#set: molecular weight=388.371 }} | ||
| + | {{#set: common name=(-)-secologanin}} | ||
| + | {{#set: consumed by=STRICTOSIDINE-SYNTHASE-RXN}} | ||
Latest revision as of 20:01, 21 March 2018
Contents
Metabolite SECOLOGANIN-CPD
- smiles:
- C=C[CH]1(C(OC=C(C(=O)OC)[CH](CC=O)1)OC2(OC(CO)C(O)C(O)C(O)2))
- common name:
- secologanin
- inchi key:
- InChIKey=CSKKDSFETGLMSB-NRZPKYKESA-N
- molecular weight:
- 388.371
- Synonym(s):
- (-)-secologanin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C[CH]1(C(OC=C(C(=O)OC)[CH](CC=O)1)OC2(OC(CO)C(O)C(O)C(O)2))" cannot be used as a page name in this wiki.
