Difference between revisions of "SECOLOGANIN-CPD"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.63-RXN 2.1.1.63-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** heat_shock_40_kda_pro...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SECOLOGANIN-CPD SECOLOGANIN-CPD] == * smiles: ** C=C[CH]1(C(OC=C(C(=O)OC)[CH](CC=O)1)OC2(OC(CO)...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SECOLOGANIN-CPD SECOLOGANIN-CPD] == |
− | * | + | * smiles: |
− | ** | + | ** C=C[CH]1(C(OC=C(C(=O)OC)[CH](CC=O)1)OC2(OC(CO)C(O)C(O)C(O)2)) |
* common name: | * common name: | ||
− | ** | + | ** secologanin |
− | ** | + | * inchi key: |
− | * | + | ** InChIKey=CSKKDSFETGLMSB-NRZPKYKESA-N |
− | ** | + | * molecular weight: |
+ | ** 388.371 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** (-)-secologanin | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[STRICTOSIDINE-SYNTHASE-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * LIPID_MAPS : LMPR0102070002 |
− | * | + | * PUBCHEM: |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=161276 161276] | |
− | ** [http:// | + | * CHEMSPIDER: |
− | + | ** [http://www.chemspider.com/Chemical-Structure.141670.html 141670] | |
− | + | * CHEBI: | |
− | * | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18002 18002] |
− | ** [http://www. | + | * LIGAND-CPD: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01852 C01852] | |
− | * | + | {{#set: smiles=C=C[CH]1(C(OC=C(C(=O)OC)[CH](CC=O)1)OC2(OC(CO)C(O)C(O)C(O)2))}} |
− | ** [http://www. | + | {{#set: common name=secologanin}} |
− | + | {{#set: inchi key=InChIKey=CSKKDSFETGLMSB-NRZPKYKESA-N}} | |
− | + | {{#set: molecular weight=388.371 }} | |
− | * | + | {{#set: common name=(-)-secologanin}} |
− | ** [http://www. | + | {{#set: consumed by=STRICTOSIDINE-SYNTHASE-RXN}} |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 20:01, 21 March 2018
Contents
Metabolite SECOLOGANIN-CPD
- smiles:
- C=C[CH]1(C(OC=C(C(=O)OC)[CH](CC=O)1)OC2(OC(CO)C(O)C(O)C(O)2))
- common name:
- secologanin
- inchi key:
- InChIKey=CSKKDSFETGLMSB-NRZPKYKESA-N
- molecular weight:
- 388.371
- Synonym(s):
- (-)-secologanin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C[CH]1(C(OC=C(C(=O)OC)[CH](CC=O)1)OC2(OC(CO)C(O)C(O)C(O)2))" cannot be used as a page name in this wiki.