Difference between revisions of "Tiso gene 5748"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2231 CPD0-2231] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)...")
 
(Created page with "Category:Gene == Gene Tiso_gene_5748 == * right end position: ** 4260 * transcription direction: ** POSITIVE * left end position: ** 2379 * centisome position: ** 18.32819...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2231 CPD0-2231] ==
+
== Gene Tiso_gene_5748 ==
* smiles:
+
* right end position:
** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))
+
** 4260
* inchi key:
+
* transcription direction:
** InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K
+
** POSITIVE
* common name:
+
* left end position:
** dIDP
+
** 2379
* molecular weight:
+
* centisome position:
** 409.165    
+
** 18.328197    
 
* Synonym(s):
 
* Synonym(s):
** deoxyinosine diphosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[5.99.1.2-RXN]]
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
* [[RXN-14228]]
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: right end position=4260}}
** [http://www.genome.jp/dbget-bin/www_bget?C01344 C01344]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: left end position=2379}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62286 62286]
+
{{#set: centisome position=18.328197   }}
* BIGG : didp
+
{{#set: reaction associated=5.99.1.2-RXN}}
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173552 46173552]
+
* HMDB : HMDB03536
+
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))}}
+
{{#set: inchi key=InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K}}
+
{{#set: common name=dIDP}}
+
{{#set: molecular weight=409.165   }}
+
{{#set: common name=deoxyinosine diphosphate}}
+
{{#set: consumed or produced by=RXN-14228}}
+

Latest revision as of 20:01, 21 March 2018

Gene Tiso_gene_5748

  • right end position:
    • 4260
  • transcription direction:
    • POSITIVE
  • left end position:
    • 2379
  • centisome position:
    • 18.328197
  • Synonym(s):

Reactions associated

Pathways associated

External links