Difference between revisions of "CPD0-2231"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13871 RXN-13871] == * direction: ** REVERSIBLE * common name: ** arylamine_n-acetyltransferase...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2231 CPD0-2231] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13871 RXN-13871] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2231 CPD0-2231] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))
 
* common name:
 
* common name:
−
** arylamine_n-acetyltransferase
+
** dIDP
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.3.1.5 EC-2.3.1.5]
+
** InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K
 +
* molecular weight:
 +
** 409.165   
 
* Synonym(s):
 
* Synonym(s):
 +
** deoxyinosine diphosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CPD-7367]][c] '''+''' 1 [[ACETYL-COA]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[CPD-14876]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN-14228]]
−
** 1 3-amino-4-hydroxybenzaldehyde[c] '''+''' 1 acetyl-CoA[c] '''<=>''' 1 H+[c] '''+''' 1 coenzyme A[c] '''+''' 1 3-acetylamino-4-hydroxybenzaldehyde[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_9942]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* LIGAND-CPD:
−
{{#set: common name=arylamine_n-acetyltransferase}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01344 C01344]
−
{{#set: ec number=EC-2.3.1.5}}
+
* HMDB : HMDB03536
−
{{#set: gene associated=Tiso_gene_9942}}
+
* CHEBI:
−
{{#set: in pathway=}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62286 62286]
−
{{#set: reconstruction category=annotation}}
+
* BIGG : didp
−
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
+
* PUBCHEM:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173552 46173552]
 +
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))}}
 +
{{#set: common name=dIDP}}
 +
{{#set: inchi key=InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K}}
 +
{{#set: molecular weight=409.165    }}
 +
{{#set: common name=deoxyinosine diphosphate}}
 +
{{#set: reversible reaction associated=RXN-14228}}

Latest revision as of 20:01, 21 March 2018

Metabolite CPD0-2231

  • smiles:
    • C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))
  • common name:
    • dIDP
  • inchi key:
    • InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K
  • molecular weight:
    • 409.165
  • Synonym(s):
    • deoxyinosine diphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD0-2231&oldid=45302"