Difference between revisions of "CPD-5821"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-262 RXN1G-262] == * direction: ** LEFT-TO-RIGHT * common name: ** cis,cis-delta7,19-3-oxo-C38...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5821 CPD-5821] == * smiles: ** C(C1(O)(NC(=O)N=C1NC(N)=O))(=O)[O-] * common name: ** 2-oxo-...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5821 CPD-5821] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(C1(O)(NC(=O)N=C1NC(N)=O))(=O)[O-] |
* common name: | * common name: | ||
| − | ** | + | ** 2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=WHKYNCPIXMNTRQ-UHFFFAOYSA-M |
| + | * molecular weight: | ||
| + | ** 201.118 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 5-hydroxy-2-oxo-4-ureido-2,5-dihydro-1H imidazole-5-carboxylate | ||
| + | ** OHCU | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-6201]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[3.5.2.17-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21145222 21145222] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.20016217.html 20016217] |
| − | {{#set: | + | * HMDB : HMDB59663 |
| − | {{#set: | + | * CHEBI: |
| − | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58639 58639] | |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C12248 C12248] | ||
| + | {{#set: smiles=C(C1(O)(NC(=O)N=C1NC(N)=O))(=O)[O-]}} | ||
| + | {{#set: common name=2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline}} | ||
| + | {{#set: inchi key=InChIKey=WHKYNCPIXMNTRQ-UHFFFAOYSA-M}} | ||
| + | {{#set: molecular weight=201.118 }} | ||
| + | {{#set: common name=5-hydroxy-2-oxo-4-ureido-2,5-dihydro-1H imidazole-5-carboxylate|OHCU}} | ||
| + | {{#set: consumed by=RXN-6201}} | ||
| + | {{#set: produced by=3.5.2.17-RXN}} | ||
Latest revision as of 20:02, 21 March 2018
Contents
Metabolite CPD-5821
- smiles:
- C(C1(O)(NC(=O)N=C1NC(N)=O))(=O)[O-]
- common name:
- 2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline
- inchi key:
- InChIKey=WHKYNCPIXMNTRQ-UHFFFAOYSA-M
- molecular weight:
- 201.118
- Synonym(s):
- 5-hydroxy-2-oxo-4-ureido-2,5-dihydro-1H imidazole-5-carboxylate
- OHCU
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C1(O)(NC(=O)N=C1NC(N)=O))(=O)[O-" cannot be used as a page name in this wiki.
