Difference between revisions of "CPD-9446"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_2614 == * left end position: ** 18398 * transcription direction: ** NEGATIVE * right end position: ** 20278 * centisome position: ** 86.036...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9446 CPD-9446] == * smiles: ** C(O)C1(OCC(O)C(O)C(O)1) * common name: ** 1,5-anhydro-D-mann...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_2614 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9446 CPD-9446] ==
−
* left end position:
+
* smiles:
−
** 18398
+
** C(O)C1(OCC(O)C(O)C(O)1)
−
* transcription direction:
+
* common name:
−
** NEGATIVE
+
** 1,5-anhydro-D-mannitol
−
* right end position:
+
* inchi key:
−
** 20278
+
** InChIKey=MPCAJMNYNOGXPB-KVTDHHQDSA-N
−
* centisome position:
+
* molecular weight:
−
** 86.036285    
+
** 164.158    
 
* Synonym(s):
 
* Synonym(s):
 +
** 1,5-anhydromannitol
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[THRESYN-RXN]]
+
* [[RXN-13064]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
−
* [[HOMOSER-THRESYN-PWY]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=18398}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445184 445184]
−
{{#set: right end position=20278}}
+
* CHEMSPIDER:
−
{{#set: centisome position=86.036285   }}
+
** [http://www.chemspider.com/Chemical-Structure.392897.html 392897]
−
{{#set: reaction associated=THRESYN-RXN}}
+
* CHEBI:
−
{{#set: pathway associated=HOMOSER-THRESYN-PWY}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49182 49182]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C16538 C16538]
 +
{{#set: smiles=C(O)C1(OCC(O)C(O)C(O)1)}}
 +
{{#set: common name=1,5-anhydro-D-mannitol}}
 +
{{#set: inchi key=InChIKey=MPCAJMNYNOGXPB-KVTDHHQDSA-N}}
 +
{{#set: molecular weight=164.158   }}
 +
{{#set: common name=1,5-anhydromannitol}}
 +
{{#set: consumed by=RXN-13064}}

Latest revision as of 20:04, 21 March 2018

Metabolite CPD-9446

  • smiles:
    • C(O)C1(OCC(O)C(O)C(O)1)
  • common name:
    • 1,5-anhydro-D-mannitol
  • inchi key:
    • InChIKey=MPCAJMNYNOGXPB-KVTDHHQDSA-N
  • molecular weight:
    • 164.158
  • Synonym(s):
    • 1,5-anhydromannitol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-9446&oldid=45665"