Difference between revisions of "Tiso gene 13230"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13010 CPD-13010] == * smiles: ** C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C=C2)O)))[N+])([O-])=O * i...")
(Created page with "Category:Gene == Gene Tiso_gene_13230 == * right end position: ** 5508 * transcription direction: ** NEGATIVE * left end position: ** 3810 * centisome position: ** 59.1890...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13010 CPD-13010] ==
+
== Gene Tiso_gene_13230 ==
−
* smiles:
+
* right end position:
−
** C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C=C2)O)))[N+])([O-])=O
+
** 5508
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RUIUIJSMLKJUDC-ZDUSSCGKSA-N
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** 3'-monoiodothyronine
+
** 3810
−
* molecular weight:
+
* centisome position:
−
** 399.184    
+
** 59.189064    
 
* Synonym(s):
 
* Synonym(s):
−
** L-tyrosine, O-(4-hydroxy-3-iodophenyl)-
 
−
** 3'-T1
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PHOSACETYLGLUCOSAMINEMUT-RXN]]
−
* [[RXN-12037]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16425]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16426]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-5514]]
 +
* [[PWY-6906]]
 +
* [[UDPNACETYLGALSYN-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=5508}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986170 50986170]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C=C2)O)))[N+])([O-])=O}}
+
{{#set: left end position=3810}}
−
{{#set: inchi key=InChIKey=RUIUIJSMLKJUDC-ZDUSSCGKSA-N}}
+
{{#set: centisome position=59.189064   }}
−
{{#set: common name=3'-monoiodothyronine}}
+
{{#set: reaction associated=PHOSACETYLGLUCOSAMINEMUT-RXN|RXN-16425|RXN-16426}}
−
{{#set: molecular weight=399.184   }}
+
{{#set: pathway associated=PWY-5514|PWY-6906|UDPNACETYLGALSYN-PWY}}
−
{{#set: common name=L-tyrosine, O-(4-hydroxy-3-iodophenyl)-|3'-T1}}
+
−
{{#set: produced by=RXN-12037}}
+

Latest revision as of 20:04, 21 March 2018

Gene Tiso_gene_13230

  • right end position:
    • 5508
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 3810
  • centisome position:
    • 59.189064
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_13230&oldid=45759"