Difference between revisions of "Tiso gene 16773"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-TP GDP-TP] == * smiles: ** C(OP([O-])(=O)OP([O-])(=O)OP([O-])(=O)[O-])C1(OC(C(O)C(OP([O-])(...")
(Created page with "Category:Gene == Gene Tiso_gene_16773 == * right end position: ** 3782 * transcription direction: ** POSITIVE * left end position: ** 1941 * centisome position: ** 47.0089...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-TP GDP-TP] ==
+
== Gene Tiso_gene_16773 ==
−
* smiles:
+
* right end position:
−
** C(OP([O-])(=O)OP([O-])(=O)OP([O-])(=O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP(O)([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
+
** 3782
−
* inchi key:
+
* transcription direction:
−
** InChIKey=KCPMACXZAITQAX-UUOKFMHZSA-H
+
** POSITIVE
−
* common name:
+
* left end position:
−
** pppGpp
+
** 1941
−
* molecular weight:
+
* centisome position:
−
** 677.095    
+
** 47.00896    
 
* Synonym(s):
 
* Synonym(s):
−
** guanosine pentaphosphate
 
−
** guanosine 3'-diphosphate 5'-triphosphate
 
−
** guanosine 5'-triphosphate,3'-diphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN0-6427]]
+
* Reaction: [[ASPARTOACYLASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[GTPPYPHOSKIN-RXN]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-13680]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: right end position=3782}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04494 C04494]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=1941}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16690 16690]
+
{{#set: centisome position=47.00896   }}
−
* BIGG : gdptp
+
{{#set: reaction associated=ASPARTOACYLASE-RXN|RXN-13680}}
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173549 46173549]
+
−
* HMDB : HMDB60480
+
−
{{#set: smiles=C(OP([O-])(=O)OP([O-])(=O)OP([O-])(=O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP(O)([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}}
+
−
{{#set: inchi key=InChIKey=KCPMACXZAITQAX-UUOKFMHZSA-H}}
+
−
{{#set: common name=pppGpp}}
+
−
{{#set: molecular weight=677.095   }}
+
−
{{#set: common name=guanosine pentaphosphate|guanosine 3'-diphosphate 5'-triphosphate|guanosine 5'-triphosphate,3'-diphosphate}}
+
−
{{#set: consumed by=RXN0-6427}}
+
−
{{#set: produced by=GTPPYPHOSKIN-RXN}}
+

Latest revision as of 20:06, 21 March 2018

Gene Tiso_gene_16773

  • right end position:
    • 3782
  • transcription direction:
    • POSITIVE
  • left end position:
    • 1941
  • centisome position:
    • 47.00896
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_16773&oldid=45990"