Difference between revisions of "TRNA-fragment"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11671 CPD-11671] == * smiles: ** C(O)CC1(=CNC2(=C1C=C(O)C=C2)) * inchi key: ** InChIKey=KQR...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-fragment tRNA-fragment] == * common name: ** a tRNA fragment * Synonym(s): == Reaction(s)...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11671 CPD-11671] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-fragment tRNA-fragment] ==
* smiles:
+
** C(O)CC1(=CNC2(=C1C=C(O)C=C2))
+
* inchi key:
+
** InChIKey=KQROHCSYOGBQGJ-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** 5-hydroxytryptophol
+
** a tRNA fragment
* molecular weight:
+
** 177.202   
+
 
* Synonym(s):
 
* Synonym(s):
** hydroxytryptophol
 
** 5-hydroxyindole-3-ethanol
 
** 5-hydroxy-1H-indole-3-ethanol
 
** 1H-indole-3-ethanol, 5-hydroxy-
 
** indole-3-ethanol, 5-hydroxy-
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10784]]
 
* [[RXN-10782]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10781]]
+
* [[RXN0-6480]]
 +
* [[3.1.26.5-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a tRNA fragment}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9061 9061]
+
{{#set: produced by=RXN0-6480|3.1.26.5-RXN}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.8708.html 8708]
+
* HMDB : HMDB01855
+
{{#set: smiles=C(O)CC1(=CNC2(=C1C=C(O)C=C2))}}
+
{{#set: inchi key=InChIKey=KQROHCSYOGBQGJ-UHFFFAOYSA-N}}
+
{{#set: common name=5-hydroxytryptophol}}
+
{{#set: molecular weight=177.202    }}
+
{{#set: common name=hydroxytryptophol|5-hydroxyindole-3-ethanol|5-hydroxy-1H-indole-3-ethanol|1H-indole-3-ethanol, 5-hydroxy-|indole-3-ethanol, 5-hydroxy-}}
+
{{#set: consumed by=RXN-10784|RXN-10782}}
+
{{#set: produced by=RXN-10781}}
+

Latest revision as of 21:06, 21 March 2018

Metabolite tRNA-fragment

  • common name:
    • a tRNA fragment
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links