Difference between revisions of "CPD-11740"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=UG4E UG4E] == * direction: ** REVERSIBLE * common name: ** UDP-glucose 4-epimerase * Synonym(s): =...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] == * smiles: ** C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-] * common name: ** ca...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=UG4E UG4E] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] ==
* direction:
+
* smiles:
** REVERSIBLE
+
** C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-]
 
* common name:
 
* common name:
** UDP-glucose 4-epimerase
+
** carboxyphosphinopyruvate
 +
* inchi key:
 +
** InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K
 +
* molecular weight:
 +
** 193.029   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-10828]]
** 1.0 [[CPD-12575]][c] '''<=>''' 1.0 [[CPD-14553]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-10827]]
** 1.0 UDP-&alpha;-D-glucose[c] '''<=>''' 1.0 UDP-&alpha;-D-galactose[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_9823]]
+
** [[pantograph]]-[[creinhardtii]]
+
== Pathways  ==
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
{{#set: common name=UDP-glucose 4-epimerase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479707 45479707]
{{#set: gene associated=Tiso_gene_9823}}
+
{{#set: smiles=C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-]}}
{{#set: in pathway=}}
+
{{#set: common name=carboxyphosphinopyruvate}}
{{#set: reconstruction category=orthology}}
+
{{#set: inchi key=InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K}}
{{#set: reconstruction tool=pantograph}}
+
{{#set: molecular weight=193.029    }}
{{#set: reconstruction source=creinhardtii}}
+
{{#set: consumed by=RXN-10828}}
 +
{{#set: produced by=RXN-10827}}

Latest revision as of 20:08, 21 March 2018

Metabolite CPD-11740

  • smiles:
    • C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-]
  • common name:
    • carboxyphosphinopyruvate
  • inchi key:
    • InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K
  • molecular weight:
    • 193.029
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-" cannot be used as a page name in this wiki.