Difference between revisions of "CPD-11740"

Latest revision as of 20:08, 21 March 2018

"C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Tiso_gene_1107 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] ==
-* left end position:
+* smiles:
-** 2373
+** C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-]
-* transcription direction:
+* common name:
-** NEGATIVE
+** carboxyphosphinopyruvate
-* right end position:
+* inchi key:
-** 8223
+** InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K
-* centisome position:
+* molecular weight:
-** 9.135004
+** 193.029
 * Synonym(s):
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[ADENYLATECYC-RXN]]
+* [[RXN-10828]]
-** in-silico_annotation
+== Reaction(s) known to produce the compound ==
-***automated-name-match
+* [[RXN-10827]]
-== Pathways associated ==
+== Reaction(s) of unknown directionality ==
 == External links  ==
-{{#set: left end position=2373}}
+* PUBCHEM:
-{{#set: transcription direction=NEGATIVE}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479707 45479707]
-{{#set: right end position=8223}}
+{{#set: smiles=C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-]}}
-{{#set: centisome position=9.135004    }}
+{{#set: common name=carboxyphosphinopyruvate}}
-{{#set: reaction associated=ADENYLATECYC-RXN}}
+{{#set: inchi key=InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K}}
+{{#set: molecular weight=193.029    }}
+{{#set: consumed by=RXN-10828}}
+{{#set: produced by=RXN-10827}}