Difference between revisions of "CPDQT-29"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-tRNAs CYS-tRNAs] == * common name: ** a tRNAcys * Synonym(s): ** TRNA(CYS) == Reaction(s)...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-29 CPDQT-29] == * smiles: ** CSCCCCCCC(=O)C([O-])=O * common name: ** 8-(methylthio)-2-ox...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-tRNAs CYS-tRNAs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-29 CPDQT-29] ==
 +
* smiles:
 +
** CSCCCCCCC(=O)C([O-])=O
 
* common name:
 
* common name:
** a tRNAcys
+
** 8-(methylthio)-2-oxooctanoate
 +
* inchi key:
 +
** InChIKey=QDZNKMGEHAHOTA-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 203.276   
 
* Synonym(s):
 
* Synonym(s):
** TRNA(CYS)
+
** 8-(methylthio)-2-oxooctanoic acid
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CYSTEINE--TRNA-LIGASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16637]]
+
* [[RXN-18205]]
 +
* [[RXNQT-4171]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a tRNAcys}}
+
* PUBCHEM:
{{#set: common name=TRNA(CYS)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237313 44237313]
{{#set: consumed by=CYSTEINE--TRNA-LIGASE-RXN}}
+
* KNAPSACK : C00007643
{{#set: produced by=RXN-16637}}
+
{{#set: smiles=CSCCCCCCC(=O)C([O-])=O}}
 +
{{#set: common name=8-(methylthio)-2-oxooctanoate}}
 +
{{#set: inchi key=InChIKey=QDZNKMGEHAHOTA-UHFFFAOYSA-M}}
 +
{{#set: molecular weight=203.276    }}
 +
{{#set: common name=8-(methylthio)-2-oxooctanoic acid}}
 +
{{#set: produced by=RXN-18205|RXNQT-4171}}

Latest revision as of 21:08, 21 March 2018

Metabolite CPDQT-29

  • smiles:
    • CSCCCCCCC(=O)C([O-])=O
  • common name:
    • 8-(methylthio)-2-oxooctanoate
  • inchi key:
    • InChIKey=QDZNKMGEHAHOTA-UHFFFAOYSA-M
  • molecular weight:
    • 203.276
  • Synonym(s):
    • 8-(methylthio)-2-oxooctanoic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • PUBCHEM:
  • KNAPSACK : C00007643
"CSCCCCCCC(=O)C([O-])=O" cannot be used as a page name in this wiki.