Difference between revisions of "Sialyloligosaccharides"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19492 CPD-19492] == * smiles: ** CCC(C([O-])=O)C(C(=O)[O-])=O * inchi key: ** InChIKey=OUGL...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sialyloligosaccharides Sialyloligosaccharides] == * common name: ** a sialyloligosaccharide * S...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sialyloligosaccharides Sialyloligosaccharides] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a sialyloligosaccharide |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3.2.1.18-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: common name=a sialyloligosaccharide}} | |
| − | + | {{#set: consumed by=3.2.1.18-RXN}} | |
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: consumed by= | + | |
| − | + | ||
Latest revision as of 20:08, 21 March 2018
Contents
Metabolite Sialyloligosaccharides
- common name:
- a sialyloligosaccharide
- Synonym(s):
