Difference between revisions of "Tiso gene 8331"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYL-PROTOCHLOROPHYLLIDE-A DIVINYL-PROTOCHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C4(C=C9...")
(Created page with "Category:Gene == Gene Tiso_gene_8331 == * right end position: ** 10316 * transcription direction: ** POSITIVE * left end position: ** 8709 * centisome position: ** 84.2344...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYL-PROTOCHLOROPHYLLIDE-A DIVINYL-PROTOCHLOROPHYLLIDE-A] ==
+
== Gene Tiso_gene_8331 ==
−
* smiles:
+
* right end position:
−
** C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** 10316
−
* common name:
+
* transcription direction:
−
** 3,8-divinyl protochlorophyllide a
+
** POSITIVE
−
* molecular weight:
+
* left end position:
−
** 608.935    
+
** 8709
 +
* centisome position:
 +
** 84.23445    
 
* Synonym(s):
 
* Synonym(s):
−
** divinylprotochlorophyllide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-5285]]
+
* Reaction: [[MANNONDEHYDRAT-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-5284]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
−
* [[RXN-17487]]
+
* [[PWY-7242]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=10316}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54743931 54743931]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=8709}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58632 58632]
+
{{#set: centisome position=84.23445    }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=MANNONDEHYDRAT-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11831 C11831]
+
{{#set: pathway associated=PWY-7242}}
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
−
{{#set: common name=3,8-divinyl protochlorophyllide a}}
+
−
{{#set: molecular weight=608.935    }}
+
−
{{#set: common name=divinylprotochlorophyllide}}
+
−
{{#set: consumed by=RXN-5285}}
+
−
{{#set: produced by=RXN-5284}}
+
−
{{#set: reversible reaction associated=RXN-17487}}
+

Latest revision as of 21:09, 21 March 2018

Gene Tiso_gene_8331

  • right end position:
    • 10316
  • transcription direction:
    • POSITIVE
  • left end position:
    • 8709
  • centisome position:
    • 84.23445
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_8331&oldid=46372"