Difference between revisions of "Tiso gene 10634"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13575 CPD-13575] == * smiles: ** CC1(C(=CCOP([O-])(=O)[O-])SC(C(=O)[O-])N=1) * inchi key: *...")
(Created page with "Category:Gene == Gene Tiso_gene_10634 == * right end position: ** 6792 * transcription direction: ** POSITIVE * left end position: ** 5670 * centisome position: ** 46.1425...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13575 CPD-13575] ==
+
== Gene Tiso_gene_10634 ==
−
* smiles:
+
* right end position:
−
** CC1(C(=CCOP([O-])(=O)[O-])SC(C(=O)[O-])N=1)
+
** 6792
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PQMCQNOVNFNPFJ-HYIMLASBSA-K
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 2-[(2R,5Z)-2-carboxy-4-methylthiazol-5(2H)-ylidene]ethyl phosphate
+
** 5670
−
* molecular weight:
+
* centisome position:
−
** 264.169    
+
** 46.14258    
 
* Synonym(s):
 
* Synonym(s):
−
** cThz*-P
 
−
** thiazole tautomer
 
−
** (R,Z)-2-(2-carboxy-4-methylthiazol-5(2H)-ylidene)ethyl phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12611]]
+
* Reaction: [[SERINE-O-ACETTRAN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways associated ==
 +
* [[CYSTSYN-PWY]]
 +
* [[PWY-7274]]
 +
* [[PWY-6936]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=6792}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53477654 53477654]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=5670}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62899 62899]
+
{{#set: centisome position=46.14258   }}
−
{{#set: smiles=CC1(C(=CCOP([O-])(=O)[O-])SC(C(=O)[O-])N=1)}}
+
{{#set: reaction associated=SERINE-O-ACETTRAN-RXN}}
−
{{#set: inchi key=InChIKey=PQMCQNOVNFNPFJ-HYIMLASBSA-K}}
+
{{#set: pathway associated=CYSTSYN-PWY|PWY-7274|PWY-6936}}
−
{{#set: common name=2-[(2R,5Z)-2-carboxy-4-methylthiazol-5(2H)-ylidene]ethyl phosphate}}
+
−
{{#set: molecular weight=264.169   }}
+
−
{{#set: common name=cThz*-P|thiazole tautomer|(R,Z)-2-(2-carboxy-4-methylthiazol-5(2H)-ylidene)ethyl phosphate}}
+
−
{{#set: consumed by=RXN-12611}}
+

Latest revision as of 20:09, 21 March 2018

Gene Tiso_gene_10634

  • right end position:
    • 6792
  • transcription direction:
    • POSITIVE
  • left end position:
    • 5670
  • centisome position:
    • 46.14258
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_10634&oldid=46423"