Difference between revisions of "Trans-D3-cis-D7-tetradecenoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15104 CPD-15104] == * smiles: ** CCC(O)(C)C(=O)C(=O)[O-] * inchi key: ** InChIKey=YJVOWRAWF...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Trans-D3-cis-D7-tetradecenoyl-ACPs Trans-D3-cis-D7-tetradecenoyl-ACPs] == * common name: ** a t...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15104 CPD-15104] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Trans-D3-cis-D7-tetradecenoyl-ACPs Trans-D3-cis-D7-tetradecenoyl-ACPs] ==
* smiles:
+
** CCC(O)(C)C(=O)C(=O)[O-]
+
* inchi key:
+
** InChIKey=YJVOWRAWFXRESP-ZCFIWIBFSA-M
+
 
* common name:
 
* common name:
** (R)-3-hydroxy-3-methyl-2-oxopentanoate
+
** a trans-Δ3-cis-Δ7-tetradecenoyl-[acp]
* molecular weight:
+
** 145.135   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[R05068]]
+
* [[RXN-10657]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-10656]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-14106]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a trans-Δ3-cis-Δ7-tetradecenoyl-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20846131 20846131]
+
{{#set: consumed by=RXN-10657}}
* CHEBI:
+
{{#set: produced by=RXN-10656}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49257 49257]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C14463 C14463]
+
{{#set: smiles=CCC(O)(C)C(=O)C(=O)[O-]}}
+
{{#set: inchi key=InChIKey=YJVOWRAWFXRESP-ZCFIWIBFSA-M}}
+
{{#set: common name=(R)-3-hydroxy-3-methyl-2-oxopentanoate}}
+
{{#set: molecular weight=145.135    }}
+
{{#set: consumed by=R05068}}
+
{{#set: reversible reaction associated=RXN-14106}}
+

Latest revision as of 20:10, 21 March 2018

Metabolite Trans-D3-cis-D7-tetradecenoyl-ACPs

  • common name:
    • a trans-Δ3-cis-Δ7-tetradecenoyl-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a trans-Δ3-cis-Δ7-tetradecenoyl-[acp" cannot be used as a page name in this wiki.