Difference between revisions of "Tiso gene 14208"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10809 CPD-10809] == * smiles: ** C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-] *...") |
(Created page with "Category:Gene == Gene Tiso_gene_14208 == * Synonym(s): == Reactions associated == * Reaction: 3.4.21.89-RXN ** Source: orthology-esiliculosus * Reaction: RXN0-3...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_14208 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[3.4.21.89-RXN]] |
− | + | ** Source: [[orthology-esiliculosus]] | |
− | == | + | * Reaction: [[RXN0-3201]] |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=3.4.21.89-RXN|RXN0-3201}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 20:10, 21 March 2018
Gene Tiso_gene_14208
- Synonym(s):
Reactions associated
- Reaction: 3.4.21.89-RXN
- Source: orthology-esiliculosus
- Reaction: RXN0-3201
- Source: orthology-esiliculosus