Difference between revisions of "3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Tubulin-acetyl-L-lysine Tubulin-acetyl-L-lysine] == * common name: ** an [α-tubulin]-N6-a...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE] == * smiles: ** C[N+](...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE] == |
+ | * smiles: | ||
+ | ** C[N+](CCCC(C(C([O-])=O)[N+])O)(C)C | ||
* common name: | * common name: | ||
− | ** | + | ** 3-hydroxy-N6,N6,N6-trimethyl-L-lysine |
+ | * inchi key: | ||
+ | ** InChIKey=ZRJHLGYVUCPZNH-MQWKRIRWSA-O | ||
+ | * molecular weight: | ||
+ | ** 205.276 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** (5-amino-5-carboxy-4-hydroxy-pentyl)-trimethyl-ammonium | ||
+ | ** 3-hydroxy-N6,N6,N6-trimethyl-L-lysin-N6-ium | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-9896]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01259 C01259] |
+ | * HMDB : HMDB01422 | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57515 57515] | ||
+ | * METABOLIGHTS : MTBLC57515 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203146 25203146] | ||
+ | {{#set: smiles=C[N+](CCCC(C(C([O-])=O)[N+])O)(C)C}} | ||
+ | {{#set: common name=3-hydroxy-N6,N6,N6-trimethyl-L-lysine}} | ||
+ | {{#set: inchi key=InChIKey=ZRJHLGYVUCPZNH-MQWKRIRWSA-O}} | ||
+ | {{#set: molecular weight=205.276 }} | ||
+ | {{#set: common name=(5-amino-5-carboxy-4-hydroxy-pentyl)-trimethyl-ammonium|3-hydroxy-N6,N6,N6-trimethyl-L-lysin-N6-ium}} | ||
+ | {{#set: consumed by=RXN-9896}} |
Latest revision as of 20:10, 21 March 2018
Contents
Metabolite 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE
- smiles:
- C[N+](CCCC(C(C([O-])=O)[N+])O)(C)C
- common name:
- 3-hydroxy-N6,N6,N6-trimethyl-L-lysine
- inchi key:
- InChIKey=ZRJHLGYVUCPZNH-MQWKRIRWSA-O
- molecular weight:
- 205.276
- Synonym(s):
- (5-amino-5-carboxy-4-hydroxy-pentyl)-trimethyl-ammonium
- 3-hydroxy-N6,N6,N6-trimethyl-L-lysin-N6-ium
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C[N+](CCCC(C(C([O-])=O)[N+])O)(C)C" cannot be used as a page name in this wiki.