Difference between revisions of "CPD-11715"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19167 CPD-19167] == * smiles: ** CCCCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11715 CPD-11715] == * smiles: ** C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1) * common name: ** phenyla...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11715 CPD-11715] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1) |
* common name: | * common name: | ||
− | ** | + | ** phenylacetylglycine |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=UTYVDVLMYQPLQB-UHFFFAOYSA-M |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 192.194 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** phenaceturic acid |
− | ** | + | ** phenacetylglycine |
+ | ** N-phenacetylglycine | ||
+ | ** N-phenylacetylglycine | ||
+ | ** N-(phenylacetyl)glycine | ||
+ | ** glycine, N-(phenylacetyl)- | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-10821]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: smiles= | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4229702 4229702] |
− | {{#set: inchi key=InChIKey= | + | * CHEMSPIDER: |
− | {{#set: molecular weight= | + | ** [http://www.chemspider.com/Chemical-Structure.3438658.html 3438658] |
− | {{#set: common name= | + | * CHEBI: |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60874 60874] | |
− | {{#set: produced by=RXN- | + | {{#set: smiles=C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1)}} |
+ | {{#set: common name=phenylacetylglycine}} | ||
+ | {{#set: inchi key=InChIKey=UTYVDVLMYQPLQB-UHFFFAOYSA-M}} | ||
+ | {{#set: molecular weight=192.194 }} | ||
+ | {{#set: common name=phenaceturic acid|phenacetylglycine|N-phenacetylglycine|N-phenylacetylglycine|N-(phenylacetyl)glycine|glycine, N-(phenylacetyl)-}} | ||
+ | {{#set: produced by=RXN-10821}} |
Latest revision as of 20:11, 21 March 2018
Contents
Metabolite CPD-11715
- smiles:
- C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1)
- common name:
- phenylacetylglycine
- inchi key:
- InChIKey=UTYVDVLMYQPLQB-UHFFFAOYSA-M
- molecular weight:
- 192.194
- Synonym(s):
- phenaceturic acid
- phenacetylglycine
- N-phenacetylglycine
- N-phenylacetylglycine
- N-(phenylacetyl)glycine
- glycine, N-(phenylacetyl)-
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1)" cannot be used as a page name in this wiki.