Difference between revisions of "Tiso gene 12321"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7025 CPD-7025] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C * inchi key: *...")
(Created page with "Category:Gene == Gene Tiso_gene_12321 == * right end position: ** 1964 * transcription direction: ** POSITIVE * left end position: ** 227 * centisome position: ** 3.178381...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7025 CPD-7025] ==
+
== Gene Tiso_gene_12321 ==
−
* smiles:
+
* right end position:
−
** CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C
+
** 1964
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YRXRHZOKDFCXIB-PYDDKJGSSA-L
+
** POSITIVE
−
* common name:
+
* left end position:
−
** phytyl monophosphate
+
** 227
−
* molecular weight:
+
* centisome position:
−
** 374.499    
+
** 3.1783814    
 
* Synonym(s):
 
* Synonym(s):
−
** phytolmonophosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[GAMMA-GLUTAMYLTRANSFERASE-RXN]]
−
* [[RXN-7683]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-18092]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-6601]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-9157]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN66-336]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-4041]]
 +
* [[PWY-5826]]
 +
* [[PWY66-375]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=1964}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245113 25245113]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=227}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75483 75483]
+
{{#set: centisome position=3.1783814   }}
−
{{#set: smiles=CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C}}
+
{{#set: reaction associated=GAMMA-GLUTAMYLTRANSFERASE-RXN|RXN-18092|RXN-6601|RXN-9157|RXN66-336}}
−
{{#set: inchi key=InChIKey=YRXRHZOKDFCXIB-PYDDKJGSSA-L}}
+
{{#set: pathway associated=PWY-4041|PWY-5826|PWY66-375}}
−
{{#set: common name=phytyl monophosphate}}
+
−
{{#set: molecular weight=374.499   }}
+
−
{{#set: common name=phytolmonophosphate}}
+
−
{{#set: produced by=RXN-7683}}
+

Latest revision as of 20:11, 21 March 2018

Gene Tiso_gene_12321

  • right end position:
    • 1964
  • transcription direction:
    • POSITIVE
  • left end position:
    • 227
  • centisome position:
    • 3.1783814
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_12321&oldid=46710"