Difference between revisions of "L-glutamyl-tRNAGln"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11641 CPD-11641] == * smiles: ** CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3)) * co...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-glutamyl-tRNAGln L-glutamyl-tRNAGln] == * common name: ** an L-glutamyl-[tRNAGln] * Synonym(s...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-glutamyl-tRNAGln L-glutamyl-tRNAGln] == |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an L-glutamyl-[tRNAGln] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** an L-glutamyl-tRNA(gln) |
| + | ** glu-tRNA(gln) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[6.3.5.7-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-9386]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=an L-glutamyl-[tRNAGln]}} | |
| − | + | {{#set: common name=an L-glutamyl-tRNA(gln)|glu-tRNA(gln)}} | |
| − | + | {{#set: consumed by=6.3.5.7-RXN}} | |
| − | + | {{#set: produced by=RXN-9386}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 20:12, 21 March 2018
Contents
Metabolite L-glutamyl-tRNAGln
- common name:
- an L-glutamyl-[tRNAGln]
- Synonym(s):
- an L-glutamyl-tRNA(gln)
- glu-tRNA(gln)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"an L-glutamyl-[tRNAGln" cannot be used as a page name in this wiki.
