Difference between revisions of "1.3.99.23-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] == * smiles: ** C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N)) * inchi key...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.3.99.23-RXN 1.3.99.23-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** carotenoid_isomeras...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.3.99.23-RXN 1.3.99.23-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** carotenoid_isomerase |
− | * | + | ** carotene_isomerase |
− | ** | + | ** fad_nad_-binding_oxidoreductase_domain-containing_protein |
+ | ** carotenoid_isomerase-like_protein | ||
+ | ** all-trans-_-dihydroretinol_saturase | ||
+ | ** ORF | ||
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/1.3.99.23 EC-1.3.99.23] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[CPD-13524]][c] '''+''' 1 [[Donor-H2]][c] '''=>''' 1 [[CPD-7247]][c] '''+''' 1 [[Acceptor]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 1 all-trans-retinol[c] '''+''' 1 a reduced electron acceptor[c] '''=>''' 1 all-trans-13,14-dihydroretinol[c] '''+''' 1 an oxidized electron acceptor[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_3092]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_13367]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_9534]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_16795]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_917]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_13369]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_16794]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19193 19193] |
− | * | + | * LIGAND-RXN: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07163 R07163] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | {{#set: | + | {{#set: common name=carotenoid_isomerase}} |
− | {{#set: | + | {{#set: common name=carotene_isomerase}} |
− | {{#set: common name= | + | {{#set: common name=fad_nad_-binding_oxidoreductase_domain-containing_protein}} |
− | {{#set: | + | {{#set: common name=carotenoid_isomerase-like_protein}} |
− | {{#set: common name= | + | {{#set: common name=all-trans-_-dihydroretinol_saturase}} |
− | {{#set: | + | {{#set: common name=ORF}} |
+ | {{#set: ec number=EC-1.3.99.23}} | ||
+ | {{#set: gene associated=Tiso_gene_3092|Tiso_gene_13367|Tiso_gene_9534|Tiso_gene_16795|Tiso_gene_917|Tiso_gene_13369|Tiso_gene_16794}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-in-silico_annotation}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 21:12, 21 March 2018
Contents
Reaction 1.3.99.23-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- carotenoid_isomerase
- carotene_isomerase
- fad_nad_-binding_oxidoreductase_domain-containing_protein
- carotenoid_isomerase-like_protein
- all-trans-_-dihydroretinol_saturase
- ORF
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 all-trans-retinol[c] + 1 a reduced electron acceptor[c] => 1 all-trans-13,14-dihydroretinol[c] + 1 an oxidized electron acceptor[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_3092
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_13367
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_9534
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_16795
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_917
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_13369
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_16794
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links