Difference between revisions of "Beta-D-glucan-w-C-3-substitution"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7090 CPD-7090] == * smiles: ** C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-]...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-D-glucan-w-C-3-substitution Beta-D-glucan-w-C-3-substitution] == * common name: ** a &beta...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7090 CPD-7090] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-D-glucan-w-C-3-substitution Beta-D-glucan-w-C-3-substitution] ==
* smiles:
+
** C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-])3)))
+
* inchi key:
+
** InChIKey=JKHRCGUTYDNCLE-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** delphinidin
+
** a β-D-glucan with a C3-substituted glucose
* molecular weight:
+
** 301.232   
+
 
* Synonym(s):
 
* Synonym(s):
** delfinidin
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9723]]
+
* [[3.2.1.6-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7785]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a β-D-glucan with a C3-substituted glucose}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203213 25203213]
+
{{#set: consumed by=3.2.1.6-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28436 28436]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C05908 C05908]
+
* HMDB : HMDB03074
+
{{#set: smiles=C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-])3)))}}
+
{{#set: inchi key=InChIKey=JKHRCGUTYDNCLE-UHFFFAOYSA-M}}
+
{{#set: common name=delphinidin}}
+
{{#set: molecular weight=301.232    }}
+
{{#set: common name=delfinidin}}
+
{{#set: consumed by=RXN-9723}}
+
{{#set: produced by=RXN-7785}}
+

Latest revision as of 20:13, 21 March 2018

Metabolite Beta-D-glucan-w-C-3-substitution

  • common name:
    • a β-D-glucan with a C3-substituted glucose
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links