Difference between revisions of "RXN-12124"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHYLENE-THF METHYLENE-THF] == * smiles: ** C4(NC1(N=C(N)NC(=O)C=1N3(CN(C2(=CC=C(C=C2)C(=O)NC(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12124 RXN-12124] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-5-alpha-steroid_4-deh...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHYLENE-THF METHYLENE-THF] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12124 RXN-12124] ==
−
* smiles:
+
* direction:
−
** C4(NC1(N=C(N)NC(=O)C=1N3(CN(C2(=CC=C(C=C2)C(=O)NC(CCC([O-])=O)C([O-])=O))C[CH]34)))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=QYNUQALWYRSVHF-OLZOCXBDSA-L
+
 
* common name:
 
* common name:
−
** 5,10-methylenetetrahydropteroyl mono-L-glutamate
+
** 3-oxo-5-alpha-steroid_4-dehydrogenase
−
* molecular weight:
+
* ec number:
−
** 455.429   
+
** [http://enzyme.expasy.org/EC/1.3.99.5 EC-1.3.99.5]
 
* Synonym(s):
 
* Synonym(s):
−
** N5,N10-methylenetetrahydrofolate mono-L-glutamate
 
−
** 5,10-methylenetetrahydrofolate mono-L-glutamate
 
−
** 5,10-methylene-H4PteGlu1
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[MTMOHT]]
+
* With identifiers:
−
* [[MTHFO]]
+
** 1 [[Acceptor]][c] '''+''' 1 [[CPD-342]][c] '''=>''' 1 [[Donor-H2]][c] '''+''' 1 [[ANDROST4ENE]][c]
−
* [[MTHFO_nadp]]
+
* With common name(s):
−
* [[R01226]]
+
** 1 an oxidized electron acceptor[c] '''+''' 1 5α-androstane-3,17-dione[c] '''=>''' 1 a reduced electron acceptor[c] '''+''' 1 androst-4-ene-3,17-dione[c]
−
== Reaction(s) known to produce the compound ==
+
 
−
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
−
* [[MTHFor_nadp]]
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[MLTHFtm]]
+
* Gene: [[Tiso_gene_14327]]
−
* [[R01220]]
+
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6943]], testosterone and androsterone degradation to androstendione: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6943 PWY-6943]
 +
** '''1''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* METABOLIGHTS : MTBLC15636
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=3-oxo-5-alpha-steroid_4-dehydrogenase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9548565 9548565]
+
{{#set: ec number=EC-1.3.99.5}}
−
* HMDB : HMDB01533
+
{{#set: gene associated=Tiso_gene_14327}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-6943}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00143 C00143]
+
{{#set: reconstruction category=annotation}}
−
* CHEMSPIDER:
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
** [http://www.chemspider.com/Chemical-Structure.7827491.html 7827491]
+
{{#set: reconstruction tool=pathwaytools}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15636 15636]
+
−
* BIGG : mlthf
+
−
{{#set: smiles=C4(NC1(N=C(N)NC(=O)C=1N3(CN(C2(=CC=C(C=C2)C(=O)NC(CCC([O-])=O)C([O-])=O))C[CH]34)))}}
+
−
{{#set: inchi key=InChIKey=QYNUQALWYRSVHF-OLZOCXBDSA-L}}
+
−
{{#set: common name=5,10-methylenetetrahydropteroyl mono-L-glutamate}}
+
−
{{#set: molecular weight=455.429    }}
+
−
{{#set: common name=N5,N10-methylenetetrahydrofolate mono-L-glutamate|5,10-methylenetetrahydrofolate mono-L-glutamate|5,10-methylene-H4PteGlu1}}
+
−
{{#set: consumed by=MTMOHT|MTHFO|MTHFO_nadp|R01226}}
+
−
{{#set: reversible reaction associated=MTHFor_nadp|MLTHFtm|R01220}}
+

Latest revision as of 20:13, 21 March 2018

Reaction RXN-12124

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-oxo-5-alpha-steroid_4-dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 an oxidized electron acceptor[c] + 1 5α-androstane-3,17-dione[c] => 1 a reduced electron acceptor[c] + 1 androst-4-ene-3,17-dione[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6943, testosterone and androsterone degradation to androstendione: PWY-6943
    • 1 reactions found over 3 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-12124&oldid=46955"