Difference between revisions of "CPD-19487"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ENOYL-ACP-REDUCT-NADPH-RXN ENOYL-ACP-REDUCT-NADPH-RXN] == * direction: ** LEFT-TO-RIGHT * common na...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19487 CPD-19487] == * smiles: ** CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * common name: ** 3-is...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19487 CPD-19487] == |
− | * | + | * smiles: |
− | ** | + | ** CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] |
* common name: | * common name: | ||
− | ** | + | ** 3-isopropyl-10-(methylthio)-2-oxodecanoate |
− | * | + | * inchi key: |
− | + | ** InChIKey=UKHZBTWECWUVPH-UHFFFAOYSA-L | |
− | ** | + | * molecular weight: |
− | + | ** 274.331 | |
− | * | + | |
− | ** | + | |
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-18201]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-18200]] | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | = | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: smiles=CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]}} | |
− | + | {{#set: common name=3-isopropyl-10-(methylthio)-2-oxodecanoate}} | |
− | + | {{#set: inchi key=InChIKey=UKHZBTWECWUVPH-UHFFFAOYSA-L}} | |
− | + | {{#set: molecular weight=274.331 }} | |
− | + | {{#set: consumed by=RXN-18201}} | |
− | + | {{#set: reversible reaction associated=RXN-18200}} | |
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:13, 21 March 2018
Contents
Metabolite CPD-19487
- smiles:
- CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]
- common name:
- 3-isopropyl-10-(methylthio)-2-oxodecanoate
- inchi key:
- InChIKey=UKHZBTWECWUVPH-UHFFFAOYSA-L
- molecular weight:
- 274.331
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.