Difference between revisions of "DMPBQ"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FORMYL-THF-GLU-N FORMYL-THF-GLU-N] == * common name: ** an N10-formyl-tetrahydrofolate * Synony...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DMPBQ DMPBQ] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C(C)=C(C)C(O)=1))C)C * common na...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DMPBQ DMPBQ] == |
| + | * smiles: | ||
| + | ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C(C)=C(C)C(O)=1))C)C | ||
* common name: | * common name: | ||
| − | ** | + | ** 2,3-dimethyl-6-phytyl-1,4-benzoquinol |
| + | * inchi key: | ||
| + | ** InChIKey=SUFZKUBNOVDJRR-WGEODTKDSA-N | ||
| + | * molecular weight: | ||
| + | ** 416.686 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-2542]] |
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71768102 71768102] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75921 75921] |
| + | * METABOLIGHTS : MTBLC75921 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C15883 C15883] | ||
| + | {{#set: smiles=CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C(C)=C(C)C(O)=1))C)C}} | ||
| + | {{#set: common name=2,3-dimethyl-6-phytyl-1,4-benzoquinol}} | ||
| + | {{#set: inchi key=InChIKey=SUFZKUBNOVDJRR-WGEODTKDSA-N}} | ||
| + | {{#set: molecular weight=416.686 }} | ||
| + | {{#set: produced by=RXN-2542}} | ||
Latest revision as of 20:14, 21 March 2018
Contents
Metabolite DMPBQ
- smiles:
- CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C(C)=C(C)C(O)=1))C)C
- common name:
- 2,3-dimethyl-6-phytyl-1,4-benzoquinol
- inchi key:
- InChIKey=SUFZKUBNOVDJRR-WGEODTKDSA-N
- molecular weight:
- 416.686
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
