Difference between revisions of "CPD-13043"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_1774 == * Synonym(s): == Reactions associated == * 3.1.1.47-RXN ** in-silico_annotation ***ec-number == Pathways associated == == Exte...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13043 CPD-13043] == * smiles: ** C12(=C(C(C([O-])=O)=CN1)C(=O)NC(N)=N2) * common name: ** 7...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_1774 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13043 CPD-13043] ==
 +
* smiles:
 +
** C12(=C(C(C([O-])=O)=CN1)C(=O)NC(N)=N2)
 +
* common name:
 +
** 7-carboxy-7-deazaguanine
 +
* inchi key:
 +
** InChIKey=XIUIRSLBMMTDSK-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 193.141   
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[3.1.1.47-RXN]]
+
* [[RXN-12093]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***ec-number
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=3.1.1.47-RXN}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852357 49852357]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61036 61036]
 +
{{#set: smiles=C12(=C(C(C([O-])=O)=CN1)C(=O)NC(N)=N2)}}
 +
{{#set: common name=7-carboxy-7-deazaguanine}}
 +
{{#set: inchi key=InChIKey=XIUIRSLBMMTDSK-UHFFFAOYSA-M}}
 +
{{#set: molecular weight=193.141    }}
 +
{{#set: consumed by=RXN-12093}}

Latest revision as of 20:14, 21 March 2018

Metabolite CPD-13043

  • smiles:
    • C12(=C(C(C([O-])=O)=CN1)C(=O)NC(N)=N2)
  • common name:
    • 7-carboxy-7-deazaguanine
  • inchi key:
    • InChIKey=XIUIRSLBMMTDSK-UHFFFAOYSA-M
  • molecular weight:
    • 193.141
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C12(=C(C(C([O-])=O)=CN1)C(=O)NC(N)=N2)" cannot be used as a page name in this wiki.