Difference between revisions of "Tiso gene 17758"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPYL-ALCOHOL SINAPYL-ALCOHOL] == * smiles: ** COC1(C=C(C=CCO)C=C(OC)C(O)=1) * common name: *...") |
(Created page with "Category:Gene == Gene Tiso_gene_17758 == * right end position: ** 5071 * transcription direction: ** POSITIVE * left end position: ** 2065 * centisome position: ** 38.3686...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_17758 == |
− | * | + | * right end position: |
− | ** | + | ** 5071 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 2065 |
− | * | + | * centisome position: |
− | ** | + | ** 38.368637 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[3.2.1.18-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=5071}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=2065}} | |
− | + | {{#set: centisome position=38.368637 }} | |
− | + | {{#set: reaction associated=3.2.1.18-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:15, 21 March 2018
Gene Tiso_gene_17758
- right end position:
- 5071
- transcription direction:
- POSITIVE
- left end position:
- 2065
- centisome position:
- 38.368637
- Synonym(s):
Reactions associated
- Reaction: 3.2.1.18-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation