Difference between revisions of "RXN0-6554"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23-DIPHOSPHOGLYCERATE 23-DIPHOSPHOGLYCERATE] == * smiles: ** C(OP(=O)([O-])[O-])C(OP(=O)([O-])[...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6554 RXN0-6554] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * ec number: ** [http:/...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23-DIPHOSPHOGLYCERATE 23-DIPHOSPHOGLYCERATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6554 RXN0-6554] ==
* smiles:
+
* direction:
** C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(=O)[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=XOHUEYCVLUUEJJ-UWTATZPHSA-I
+
 
* common name:
 
* common name:
** 2,3-diphospho-D-glycerate
+
** ORF
* molecular weight:
+
* ec number:
** 260.998   
+
** [http://enzyme.expasy.org/EC/1.3.5.2 EC-1.3.5.2]
 
* Synonym(s):
 
* Synonym(s):
** 2,3-bisphosphoglycerate
 
** D-Greenwald ester
 
** 2,3-P2-D-glycerate
 
** 2,3-bisphospho-D-glycerate
 
** 2,3-diphosphoglycerate
 
** DPG
 
** 2,3-bisPGA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1 [[Menaquinones]][c] '''+''' 1 [[DI-H-OROTATE]][c] '''=>''' 1 [[OROTATE]][c] '''+''' 1 [[Menaquinols]][c]
* [[RXN-15512]]
+
* With common name(s):
* [[RXN-15509]]
+
** 1 a menaquinone[c] '''+''' 1 (S)-dihydroorotate[c] '''=>''' 1 orotate[c] '''+''' 1 a menaquinol[c]
* [[RXN-15510]]
+
 
* [[RXN-15511]]
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_4735]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_5280]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.genome.jp/dbget-bin/www_bget?C01159 C01159]
+
{{#set: common name=ORF}}
* CHEBI:
+
{{#set: ec number=EC-1.3.5.2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58248 58248]
+
{{#set: gene associated=Tiso_gene_4735|Tiso_gene_5280}}
* METABOLIGHTS : MTBLC58248
+
{{#set: in pathway=}}
* PUBCHEM:
+
{{#set: reconstruction category=orthology|annotation}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200383 25200383]
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
* HMDB : HMDB01294
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
{{#set: smiles=C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(=O)[O-]}}
+
{{#set: inchi key=InChIKey=XOHUEYCVLUUEJJ-UWTATZPHSA-I}}
+
{{#set: common name=2,3-diphospho-D-glycerate}}
+
{{#set: molecular weight=260.998    }}
+
{{#set: common name=2,3-bisphosphoglycerate|D-Greenwald ester|2,3-P2-D-glycerate|2,3-bisphospho-D-glycerate|2,3-diphosphoglycerate|DPG|2,3-bisPGA}}
+
{{#set: reversible reaction associated=RXN-15512|RXN-15509|RXN-15510|RXN-15511}}
+

Latest revision as of 20:15, 21 March 2018

Reaction RXN0-6554

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links