Difference between revisions of "RXN0-6554"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-137 CPD1F-137] == * smiles: ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6554 RXN0-6554] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * ec number: ** [http:/...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-137 CPD1F-137] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6554 RXN0-6554] ==
* smiles:
+
* direction:
** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=RSQSQJNRHICNNH-UKJRIFTCSA-M
+
 
* common name:
 
* common name:
** gibberellin A4
+
** ORF
* molecular weight:
+
* ec number:
** 331.388   
+
** [http://enzyme.expasy.org/EC/1.3.5.2 EC-1.3.5.2]
 
* Synonym(s):
 
* Synonym(s):
** GA4
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-6550]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[Menaquinones]][c] '''+''' 1 [[DI-H-OROTATE]][c] '''=>''' 1 [[OROTATE]][c] '''+''' 1 [[Menaquinols]][c]
* [[RXN1F-165]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 a menaquinone[c] '''+''' 1 (S)-dihydroorotate[c] '''=>''' 1 orotate[c] '''+''' 1 a menaquinol[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_4735]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_5280]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* DRUGBANK : DB07815
+
{{#set: direction=LEFT-TO-RIGHT}}
* LIPID_MAPS : LMPR0104170021
+
{{#set: common name=ORF}}
* PUBCHEM:
+
{{#set: ec number=EC-1.3.5.2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245706 25245706]
+
{{#set: gene associated=Tiso_gene_4735|Tiso_gene_5280}}
* LIGAND-CPD:
+
{{#set: in pathway=}}
** [http://www.genome.jp/dbget-bin/www_bget?C11864 C11864]
+
{{#set: reconstruction category=orthology|annotation}}
* CHEBI:
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32902 32902]
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
* METABOLIGHTS : MTBLC32902
+
{{#set: smiles=C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
+
{{#set: inchi key=InChIKey=RSQSQJNRHICNNH-UKJRIFTCSA-M}}
+
{{#set: common name=gibberellin A4}}
+
{{#set: molecular weight=331.388    }}
+
{{#set: common name=GA4}}
+
{{#set: consumed by=RXN-6550}}
+
{{#set: produced by=RXN1F-165}}
+

Latest revision as of 20:15, 21 March 2018

Reaction RXN0-6554

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links