Difference between revisions of "Tiso gene 11960"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-330 CPD-330] == * smiles: ** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1) * common name: ** L-galactono-1...") |
(Created page with "Category:Gene == Gene Tiso_gene_11960 == * right end position: ** 7013 * transcription direction: ** POSITIVE * left end position: ** 1867 * centisome position: ** 25.2365...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_11960 == |
− | * | + | * right end position: |
− | ** | + | ** 7013 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 1867 |
− | * | + | * centisome position: |
− | ** | + | ** 25.23655 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN1F-20]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: ec-number |
− | == | + | ** Source: [[annotation-experimental_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5531]] | ||
+ | * [[CHLOROPHYLL-SYN]] | ||
+ | * [[PWY-7159]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=7013}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=1867}} | |
− | + | {{#set: centisome position=25.23655 }} | |
− | + | {{#set: reaction associated=RXN1F-20}} | |
− | + | {{#set: pathway associated=PWY-5531|CHLOROPHYLL-SYN|PWY-7159}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 20:15, 21 March 2018
Gene Tiso_gene_11960
- right end position:
- 7013
- transcription direction:
- POSITIVE
- left end position:
- 1867
- centisome position:
- 25.23655
- Synonym(s):
Reactions associated
- Reaction: RXN1F-20
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation