Difference between revisions of "CPD-13851"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Monocarboxylates Monocarboxylates] == * common name: ** a monocarboxylate * Synonym(s): == Rea...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13851 CPD-13851] == * smiles: ** C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Monocarboxylates Monocarboxylates] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13851 CPD-13851] ==
 +
* smiles:
 +
** C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O
 
* common name:
 
* common name:
** a monocarboxylate
+
** 2-hydroxy-dATP
 +
* inchi key:
 +
** InChIKey=UOACBPRDWRDEHJ-KVQBGUIXSA-J
 +
* molecular weight:
 +
** 503.152   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-hydroxy-2'-deoxyadenosine 5'-triphosphate
 +
** 2'-deoxyisoguanosine triphosphate
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14290]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[AMIDASE-RXN]]
 
 
== External links  ==
 
== External links  ==
{{#set: common name=a monocarboxylate}}
+
* PUBCHEM:
{{#set: consumed or produced by=AMIDASE-RXN}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289402 86289402]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77897 77897]
 +
{{#set: smiles=C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O}}
 +
{{#set: common name=2-hydroxy-dATP}}
 +
{{#set: inchi key=InChIKey=UOACBPRDWRDEHJ-KVQBGUIXSA-J}}
 +
{{#set: molecular weight=503.152    }}
 +
{{#set: common name=2-hydroxy-2'-deoxyadenosine 5'-triphosphate|2'-deoxyisoguanosine triphosphate}}
 +
{{#set: produced by=RXN-14290}}

Latest revision as of 20:17, 21 March 2018

Metabolite CPD-13851

  • smiles:
    • C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O
  • common name:
    • 2-hydroxy-dATP
  • inchi key:
    • InChIKey=UOACBPRDWRDEHJ-KVQBGUIXSA-J
  • molecular weight:
    • 503.152
  • Synonym(s):
    • 2-hydroxy-2'-deoxyadenosine 5'-triphosphate
    • 2'-deoxyisoguanosine triphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O" cannot be used as a page name in this wiki.