Difference between revisions of "Tiso gene 570"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-90 CPD1F-90] == * smiles: ** C3(C=C(O)C=CC(C1(=C([O-])C(=O)C2(C(O)=CC(O)=CC(O1)=2)))=3) *...") |
(Created page with "Category:Gene == Gene Tiso_gene_570 == * right end position: ** 23045 * transcription direction: ** POSITIVE * left end position: ** 15624 * centisome position: ** 49.6504...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_570 == |
| − | * | + | * right end position: |
| − | ** | + | ** 23045 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| − | * | + | * left end position: |
| − | ** | + | ** 15624 |
| − | * | + | * centisome position: |
| − | ** | + | ** 49.65044 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reactions associated == |
| − | * [[ | + | * Reaction: [[ATPASE-RXN]] |
| − | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
| − | + | *** Assignment: ec-number | |
| − | * | + | == Pathways associated == |
| − | == | + | |
== External links == | == External links == | ||
| − | + | {{#set: right end position=23045}} | |
| − | + | {{#set: transcription direction=POSITIVE}} | |
| − | + | {{#set: left end position=15624}} | |
| − | + | {{#set: centisome position=49.65044 }} | |
| − | + | {{#set: reaction associated=ATPASE-RXN}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 20:18, 21 March 2018
Gene Tiso_gene_570
- right end position:
- 23045
- transcription direction:
- POSITIVE
- left end position:
- 15624
- centisome position:
- 49.65044
- Synonym(s):
Reactions associated
- Reaction: ATPASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
