Difference between revisions of "CPD-17046"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-4 CPDQT-4] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1) * inchi key: ** InCh...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17046 CPD-17046] == * smiles: ** C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)NC(=O)C...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17046 CPD-17046] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O)(CO)NC(=O)2))C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine |
| + | * inchi key: | ||
| + | ** InChIKey=YJISLDWVIYDIOE-WGTGPSAHSA-L | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 842.848 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-DKP | ||
| + | ** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)piperazine-2,5-dione | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-15680]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657797 90657797] |
| − | + | {{#set: smiles=C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O)(CO)NC(=O)2))C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}} | |
| − | + | {{#set: common name=3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine}} | |
| − | + | {{#set: inchi key=InChIKey=YJISLDWVIYDIOE-WGTGPSAHSA-L}} | |
| − | + | {{#set: molecular weight=842.848 }} | |
| − | {{#set: smiles=C(O) | + | {{#set: common name=3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-DKP|3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)piperazine-2,5-dione}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: produced by=RXN-15680}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:18, 21 March 2018
Contents
Metabolite CPD-17046
- smiles:
- C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O)(CO)NC(=O)2))C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
- common name:
- 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine
- inchi key:
- InChIKey=YJISLDWVIYDIOE-WGTGPSAHSA-L
- molecular weight:
- 842.848
- Synonym(s):
- 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-DKP
- 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)piperazine-2,5-dione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O)(CO)NC(=O)2))C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O" cannot be used as a page name in this wiki.
