|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-COA-ACETYLTRANSFER-RXN ACETYL-COA-ACETYLTRANSFER-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-AMP PHOSPHORIBOSYL-AMP] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** C(C4(C(C(C(N3(C(C2(=C(N(C1(C(C(C(O1)COP([O-])(=O)[O-])O)O))C=N2)N=C3))=N))O4)O)O))OP([O-])([O-])=O |
− | * ec number: | + | * common name: |
− | ** [http://enzyme.expasy.org/EC/2.3.1.9 EC-2.3.1.9] | + | ** 1-(5-phospho-β-D-ribosyl)-AMP |
| + | * inchi key: |
| + | ** InChIKey=RTQMRTSPTLIIHM-KEOHHSTQSA-J |
| + | * molecular weight: |
| + | ** 555.288 |
| * Synonym(s): | | * Synonym(s): |
| + | ** 1-(5-phosphoribosyl)-AMP |
| + | ** phosphoribosyl-AMP |
| + | ** 5-phosphoribosyl-AMP |
| + | ** N-(5-phospho-D-ribosyl)-AMP |
| + | ** N-(5'-phospho-D-ribosyl)-AMP |
| + | ** N1-(5-phospho-D-ribosyl)-AMP |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[HISTCYCLOHYD-RXN]] |
− | ** 2 [[ACETYL-COA]][c] '''<=>''' 1 [[CO-A]][c] '''+''' 1 [[ACETOACETYL-COA]][c]
| + | * [[PRACH]] |
− | * With common name(s):
| + | == Reaction(s) known to produce the compound == |
− | ** 2 acetyl-CoA[c] '''<=>''' 1 coenzyme A[c] '''+''' 1 acetoacetyl-CoA[c]
| + | * [[HISTPRATPHYD-RXN]] |
− | | + | * [[PRADP]] |
− | == Genes associated with this reaction ==
| + | == Reaction(s) of unknown directionality == |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_16181]]
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | * [[Tiso_gene_15327]]
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | ** [[pantograph]]-[[creinhardtii]]
| + | |
− | * [[Tiso_gene_17451]]
| + | |
− | ** [[pantograph]]-[[synechocystis]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | == Pathways ==
| + | |
− | * [[P162-PWY]], L-glutamate degradation V (via hydroxyglutarate): [http://metacyc.org/META/NEW-IMAGE?object=P162-PWY P162-PWY]
| + | |
− | ** '''4''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[PWY-5177]], glutaryl-CoA degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5177 PWY-5177]
| + | |
− | ** '''3''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-6583]], pyruvate fermentation to butanol I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6583 PWY-6583]
| + | |
− | ** '''4''' reactions found over '''8''' reactions in the full pathway
| + | |
− | * [[P163-PWY]], L-lysine fermentation to acetate and butanoate: [http://metacyc.org/META/NEW-IMAGE?object=P163-PWY P163-PWY]
| + | |
− | ** '''1''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[PWY-6883]], pyruvate fermentation to butanol II (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6883 PWY-6883]
| + | |
− | ** '''4''' reactions found over '''6''' reactions in the full pathway
| + | |
− | * [[PWY-5676]], acetyl-CoA fermentation to butanoate II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5676 PWY-5676] | + | |
− | ** '''2''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[PWY-6588]], pyruvate fermentation to acetone: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6588 PWY-6588] | + | |
− | ** '''2''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-7779]], methyl tert-butyl ether degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7779 PWY-7779]
| + | |
− | ** '''2''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[PWY-7778]], 2-methylpropene degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7778 PWY-7778]
| + | |
− | ** '''2''' reactions found over '''8''' reactions in the full pathway
| + | |
− | * [[PWY1-3]], polyhydroxybutanoate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY1-3 PWY1-3]
| + | |
− | ** '''2''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[PWY-5789]], 3-hydroxypropanoate/4-hydroxybutanate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5789 PWY-5789]
| + | |
− | ** '''8''' reactions found over '''16''' reactions in the full pathway
| + | |
− | * [[PWY-6876]], isopropanol biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6876 PWY-6876]
| + | |
− | ** '''2''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[CENTFERM-PWY]], pyruvate fermentation to butanoate: [http://metacyc.org/META/NEW-IMAGE?object=CENTFERM-PWY CENTFERM-PWY]
| + | |
− | ** '''3''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[PWY-7391]], isoprene biosynthesis II (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7391 PWY-7391]
| + | |
− | ** '''6''' reactions found over '''8''' reactions in the full pathway
| + | |
− | * [[PWY-5741]], ethylmalonyl-CoA pathway: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5741 PWY-5741]
| + | |
− | ** '''2''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[PWY-6174]], mevalonate pathway II (archaea): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6174 PWY-6174] | + | |
− | ** '''5''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[ACETOACETATE-DEG-PWY]], acetoacetate degradation (to acetyl CoA): [http://metacyc.org/META/NEW-IMAGE?object=ACETOACETATE-DEG-PWY ACETOACETATE-DEG-PWY] | + | |
− | ** '''1''' reactions found over '''2''' reactions in the full pathway
| + | |
− | * [[PWY66-367]], ketogenesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-367 PWY66-367]
| + | |
− | ** '''5''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-7216]], (R)- and (S)-3-hydroxybutanoate biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7216 PWY-7216]
| + | |
− | ** '''3''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-922]], mevalonate pathway I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-922 PWY-922]
| + | |
− | ** '''6''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[PWY66-368]], ketolysis: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-368 PWY66-368]
| + | |
− | ** '''3''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[PWY-7401]], crotonate fermentation (to acetate and cyclohexane carboxylate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7401 PWY-7401]
| + | |
− | ** '''5''' reactions found over '''17''' reactions in the full pathway
| + | |
− | * [[PWY-6863]], pyruvate fermentation to hexanol (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6863 PWY-6863]
| + | |
− | ** '''5''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[PWY-7524]], mevalonate pathway III (archaea): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7524 PWY-7524]
| + | |
− | ** '''4''' reactions found over '''8''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * Category: [[orthology]]
| + | |
− | ** Source: [[orthology-athaliana]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | ** Source: [[orthology-creinhardtii]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | ** Source: [[orthology-synechocystis]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
| == External links == | | == External links == |
− | * RHEA:
| + | * LIGAND-CPD: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21036 21036]
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C02741 C02741] |
− | * LIGAND-RXN: | + | * HMDB : HMDB12276 |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00238 R00238] | + | * CHEBI: |
− | * UNIPROT: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59457 59457] |
− | ** [http://www.uniprot.org/uniprot/Q8CAY6 Q8CAY6] | + | * BIGG : prbamp |
− | ** [http://www.uniprot.org/uniprot/P41338 P41338] | + | * PUBCHEM: |
− | ** [http://www.uniprot.org/uniprot/P45362 P45362]
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45480652 45480652] |
− | ** [http://www.uniprot.org/uniprot/Q9BWD1 Q9BWD1]
| + | {{#set: smiles=C(C4(C(C(C(N3(C(C2(=C(N(C1(C(C(C(O1)COP([O-])(=O)[O-])O)O))C=N2)N=C3))=N))O4)O)O))OP([O-])([O-])=O}} |
− | ** [http://www.uniprot.org/uniprot/P45359 P45359] | + | {{#set: common name=1-(5-phospho-β-D-ribosyl)-AMP}} |
− | ** [http://www.uniprot.org/uniprot/P24752 P24752] | + | {{#set: inchi key=InChIKey=RTQMRTSPTLIIHM-KEOHHSTQSA-J}} |
− | ** [http://www.uniprot.org/uniprot/Q12598 Q12598] | + | {{#set: molecular weight=555.288 }} |
− | ** [http://www.uniprot.org/uniprot/P45369 P45369]
| + | {{#set: common name=1-(5-phosphoribosyl)-AMP|phosphoribosyl-AMP|5-phosphoribosyl-AMP|N-(5-phospho-D-ribosyl)-AMP|N-(5'-phospho-D-ribosyl)-AMP|N1-(5-phospho-D-ribosyl)-AMP}} |
− | ** [http://www.uniprot.org/uniprot/P46707 P46707]
| + | {{#set: consumed by=HISTCYCLOHYD-RXN|PRACH}} |
− | ** [http://www.uniprot.org/uniprot/P73825 P73825]
| + | {{#set: produced by=HISTPRATPHYD-RXN|PRADP}} |
− | ** [http://www.uniprot.org/uniprot/Q43637 Q43637]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9UQW6 Q9UQW6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Z3Y4 Q9Z3Y4]
| + | |
− | ** [http://www.uniprot.org/uniprot/P77852 P77852]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9XD81 Q9XD81]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZGI9 Q9ZGI9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9L8E0 Q9L8E0]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14611 P14611]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07097 P07097]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17764 P17764]
| + | |
− | {{#set: direction=REVERSIBLE}} | + | |
− | {{#set: ec number=EC-2.3.1.9}} | + | |
− | {{#set: gene associated=Tiso_gene_16181|Tiso_gene_15327|Tiso_gene_17451}} | + | |
− | {{#set: in pathway=P162-PWY|PWY-5177|PWY-6583|P163-PWY|PWY-6883|PWY-5676|PWY-6588|PWY-7779|PWY-7778|PWY1-3|PWY-5789|PWY-6876|CENTFERM-PWY|PWY-7391|PWY-5741|PWY-6174|ACETOACETATE-DEG-PWY|PWY66-367|PWY-7216|PWY-922|PWY66-368|PWY-7401|PWY-6863|PWY-7524}} | + | |
− | {{#set: reconstruction category=orthology}} | + | |
− | {{#set: reconstruction source=orthology-athaliana|orthology-creinhardtii|orthology-synechocystis|orthology-esiliculosus}} | + | |
− | {{#set: reconstruction tool=pantograph}}
| + | |