|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DTDPGLUCOSEPP-RXN DTDPGLUCOSEPP-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5661 CPD-5661] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2(C(=CCCC2(C)C)C))C |
− | * ec number: | + | * common name: |
− | ** [http://enzyme.expasy.org/EC/2.7.7.24 EC-2.7.7.24] | + | ** zeinoxanthin |
| + | * inchi key: |
| + | ** InChIKey=NBZANZVJRKXVBH-SZVYCNKZSA-N |
| + | * molecular weight: |
| + | ** 552.882 |
| * Synonym(s): | | * Synonym(s): |
| + | ** β,ε-carotene-3-ol |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[RXN-5962]] |
− | ** 1 [[TTP]][c] '''+''' 1 [[GLC-1-P]][c] '''+''' 1 [[PROTON]][c] '''<=>''' 1 [[PPI]][c] '''+''' 1 [[DTDP-D-GLUCOSE]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | * [[RXN-5961]] |
− | ** 1 dTTP[c] '''+''' 1 α-D-glucopyranose 1-phosphate[c] '''+''' 1 H+[c] '''<=>''' 1 diphosphate[c] '''+''' 1 dTDP-α-D-glucose[c]
| + | == Reaction(s) of unknown directionality == |
− | | + | |
− | == Genes associated with this reaction ==
| + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_14704]]
| + | |
− | ** [[pantograph]]-[[synechocystis]]
| + | |
− | == Pathways ==
| + | |
− | * [[PWY-7315]], dTDP-N-acetylthomosamine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7315 PWY-7315]
| + | |
− | ** '''2''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-7316]], dTDP-N-acetylviosamine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7316 PWY-7316]
| + | |
− | ** '''2''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-6953]], dTDP-3-acetamido-α-D-fucose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6953 PWY-6953]
| + | |
− | ** '''2''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-7301]], dTDP-4-O-demethyl-β-L-noviose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7301 PWY-7301] | + | |
− | ** '''2''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-7657]], dTDP-β-L-digitoxose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7657 PWY-7657]
| + | |
− | ** '''2''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[PWY-7318]], dTDP-3-acetamido-3,6-dideoxy-α-D-glucose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7318 PWY-7318]
| + | |
− | ** '''2''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-7312]], dTDP-D-β-fucofuranose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7312 PWY-7312]
| + | |
− | ** '''2''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-6942]], dTDP-D-desosamine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6942 PWY-6942]
| + | |
− | ** '''2''' reactions found over '''6''' reactions in the full pathway
| + | |
− | * [[PWY-7104]], dTDP-L-megosamine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7104 PWY-7104] | + | |
− | ** '''2''' reactions found over '''8''' reactions in the full pathway
| + | |
− | * [[PWY-7814]], dTDP-L-daunosamine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7814 PWY-7814]
| + | |
− | ** '''2''' reactions found over '''6''' reactions in the full pathway
| + | |
− | * [[PWY-7440]], dTDP-β-L-4-epi-vancosamine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7440 PWY-7440]
| + | |
− | ** '''2''' reactions found over '''8''' reactions in the full pathway
| + | |
− | * [[DTDPRHAMSYN-PWY]], dTDP-L-rhamnose biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=DTDPRHAMSYN-PWY DTDPRHAMSYN-PWY]
| + | |
− | ** '''3''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-6808]], dTDP-D-forosamine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6808 PWY-6808]
| + | |
− | ** '''2''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY-7413]], dTDP-6-deoxy-α-D-allose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7413 PWY-7413]
| + | |
− | ** '''2''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-6976]], dTDP-L-mycarose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6976 PWY-6976]
| + | |
− | ** '''2''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[PWY-7688]], dTDP-D-ravidosamine and dTDP-4-acetyl-D-ravidosamine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7688 PWY-7688]
| + | |
− | ** '''2''' reactions found over '''6''' reactions in the full pathway
| + | |
− | * [[PWY-6974]], dTDP-L-olivose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6974 PWY-6974]
| + | |
− | ** '''2''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[PWY-6973]], dTDP-D-olivose, dTDP-D-oliose and dTDP-D-mycarose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6973 PWY-6973]
| + | |
− | ** '''2''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY-3221]], dTDP-L-rhamnose biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3221 PWY-3221]
| + | |
− | ** '''2''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[PWY-7414]], dTDP-α-D-mycaminose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7414 PWY-7414]
| + | |
− | ** '''2''' reactions found over '''5''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * Category: [[orthology]]
| + | |
− | ** Source: [[orthology-synechocystis]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15225 15225] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10311902 10311902] |
− | * LIGAND-RXN: | + | * CHEMSPIDER: |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R02328 R02328] | + | ** [http://www.chemspider.com/Chemical-Structure.8487368.html 8487368] |
− | * UNIPROT:
| + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/P55256 P55256]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=65244 65244] |
− | ** [http://www.uniprot.org/uniprot/O27819 O27819] | + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/Q58501 Q58501] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C08590 C08590] |
− | ** [http://www.uniprot.org/uniprot/P37744 P37744]
| + | {{#set: smiles=CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2(C(=CCCC2(C)C)C))C}} |
− | ** [http://www.uniprot.org/uniprot/P72017 P72017]
| + | {{#set: common name=zeinoxanthin}} |
− | ** [http://www.uniprot.org/uniprot/P61887 P61887] | + | {{#set: inchi key=InChIKey=NBZANZVJRKXVBH-SZVYCNKZSA-N}} |
− | ** [http://www.uniprot.org/uniprot/P57040 P57040] | + | {{#set: molecular weight=552.882 }} |
− | ** [http://www.uniprot.org/uniprot/P26393 P26393]
| + | {{#set: common name=β,ε-carotene-3-ol}} |
− | ** [http://www.uniprot.org/uniprot/P55254 P55254]
| + | {{#set: consumed by=RXN-5962}} |
− | ** [http://www.uniprot.org/uniprot/P55257 P55257]
| + | {{#set: produced by=RXN-5961}} |
− | ** [http://www.uniprot.org/uniprot/P37779 P37779]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37762 P37762]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q54143 Q54143]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q56174 Q56174]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q51149 Q51149]
| + | |
− | ** [http://www.uniprot.org/uniprot/P55253 P55253]
| + | |
− | ** [http://www.uniprot.org/uniprot/O66250 O66250]
| + | |
− | ** [http://www.uniprot.org/uniprot/O08245 O08245]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9RR29 Q9RR29]
| + | |
− | {{#set: direction=REVERSIBLE}} | + | |
− | {{#set: ec number=EC-2.7.7.24}} | + | |
− | {{#set: gene associated=Tiso_gene_14704}} | + | |
− | {{#set: in pathway=PWY-7315|PWY-7316|PWY-6953|PWY-7301|PWY-7657|PWY-7318|PWY-7312|PWY-6942|PWY-7104|PWY-7814|PWY-7440|DTDPRHAMSYN-PWY|PWY-6808|PWY-7413|PWY-6976|PWY-7688|PWY-6974|PWY-6973|PWY-3221|PWY-7414}} | + | |
− | {{#set: reconstruction category=orthology}} | + | |
− | {{#set: reconstruction source=orthology-synechocystis}} | + | |
− | {{#set: reconstruction tool=pantograph}} | + | |