Difference between revisions of "CPD-5661"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_9114 == * right end position: ** 2672 * transcription direction: ** POSITIVE * left end position: ** 393 * centisome position: ** 4.0920453...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5661 CPD-5661] == * smiles: ** CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5661 CPD-5661] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2(C(=CCCC2(C)C)C))C |
− | * | + | * common name: |
− | ** | + | ** zeinoxanthin |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=NBZANZVJRKXVBH-SZVYCNKZSA-N |
− | * | + | * molecular weight: |
− | ** | + | ** 552.882 |
* Synonym(s): | * Synonym(s): | ||
+ | ** β,ε-carotene-3-ol | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-5962]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-5961]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10311902 10311902] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.8487368.html 8487368] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=65244 65244] |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C08590 C08590] | ||
+ | {{#set: smiles=CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2(C(=CCCC2(C)C)C))C}} | ||
+ | {{#set: common name=zeinoxanthin}} | ||
+ | {{#set: inchi key=InChIKey=NBZANZVJRKXVBH-SZVYCNKZSA-N}} | ||
+ | {{#set: molecular weight=552.882 }} | ||
+ | {{#set: common name=β,ε-carotene-3-ol}} | ||
+ | {{#set: consumed by=RXN-5962}} | ||
+ | {{#set: produced by=RXN-5961}} |
Latest revision as of 20:21, 21 March 2018
Contents
Metabolite CPD-5661
- smiles:
- CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2(C(=CCCC2(C)C)C))C
- common name:
- zeinoxanthin
- inchi key:
- InChIKey=NBZANZVJRKXVBH-SZVYCNKZSA-N
- molecular weight:
- 552.882
- Synonym(s):
- β,ε-carotene-3-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links