Difference between revisions of "Tiso gene 15555"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14422 CPD-14422] == * smiles: ** CCC=CCC=CCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
(Created page with "Category:Gene == Gene Tiso_gene_15555 == * right end position: ** 4730 * transcription direction: ** POSITIVE * left end position: ** 3634 * centisome position: ** 73.1776...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14422 CPD-14422] ==
+
== Gene Tiso_gene_15555 ==
−
* smiles:
+
* right end position:
−
** CCC=CCC=CCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 4730
−
* common name:
+
* transcription direction:
−
** 3-oxo-icosatrienoyl-CoA
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=DFYFQQXXTCLFNG-UBQHHBPXSA-J
+
** 3634
−
* molecular weight:
+
* centisome position:
−
** 1065.958    
+
** 73.177605    
 
* Synonym(s):
 
* Synonym(s):
−
** (9Z,12Z,15Z)-octadecatrienoyl-CoA
 
−
** 3-oxo-eicosatrienoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12994]]
+
* Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-13441]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=4730}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581047 71581047]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=3634}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74054 74054]
+
{{#set: centisome position=73.177605   }}
−
{{#set: smiles=CCC=CCC=CCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
−
{{#set: common name=3-oxo-icosatrienoyl-CoA}}
+
−
{{#set: inchi key=InChIKey=DFYFQQXXTCLFNG-UBQHHBPXSA-J}}
+
−
{{#set: molecular weight=1065.958   }}
+
−
{{#set: common name=(9Z,12Z,15Z)-octadecatrienoyl-CoA|3-oxo-eicosatrienoyl-CoA}}
+
−
{{#set: consumed by=RXN-12994}}
+
−
{{#set: produced by=RXN-13441}}
+

Latest revision as of 20:22, 21 March 2018

Gene Tiso_gene_15555

  • right end position:
    • 4730
  • transcription direction:
    • POSITIVE
  • left end position:
    • 3634
  • centisome position:
    • 73.177605
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15555&oldid=48205"