Difference between revisions of "CPD-8122"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_3363 == * left end position: ** 11847 * transcription direction: ** POSITIVE * right end position: ** 16417 * centisome position: ** 70.088...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8122 CPD-8122] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_3363 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8122 CPD-8122] ==
* left end position:
+
* smiles:
** 11847
+
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N))))(=O)[O-]
* transcription direction:
+
* common name:
** POSITIVE
+
** molybdopterin adenine dinucleotide
* right end position:
+
* inchi key:
** 16417
+
** InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K
* centisome position:
+
* molecular weight:
** 70.08815    
+
** 721.529    
 
* Synonym(s):
 
* Synonym(s):
 +
** adenylated molybdopterin
 +
** H2Dtpp-mADP
 +
** molybdopterin-AMP
 +
** adenylyl-molybdopterin
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[2.4.1.125-RXN]]
+
* [[RXN-8348]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***ec-number
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=11847}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53356704 53356704]
{{#set: right end position=16417}}
+
* CHEBI:
{{#set: centisome position=70.08815   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62727 62727]
{{#set: reaction associated=2.4.1.125-RXN}}
+
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N))))(=O)[O-]}}
 +
{{#set: common name=molybdopterin adenine dinucleotide}}
 +
{{#set: inchi key=InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K}}
 +
{{#set: molecular weight=721.529   }}
 +
{{#set: common name=adenylated molybdopterin|H2Dtpp-mADP|molybdopterin-AMP|adenylyl-molybdopterin}}
 +
{{#set: consumed by=RXN-8348}}

Latest revision as of 20:22, 21 March 2018

Metabolite CPD-8122

  • smiles:
    • C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N))))(=O)[O-]
  • common name:
    • molybdopterin adenine dinucleotide
  • inchi key:
    • InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K
  • molecular weight:
    • 721.529
  • Synonym(s):
    • adenylated molybdopterin
    • H2Dtpp-mADP
    • molybdopterin-AMP
    • adenylyl-molybdopterin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N))))(=O)[O-" cannot be used as a page name in this wiki.