Difference between revisions of "PWY-5523"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRYPTAMINE TRYPTAMINE] == * smiles: ** C([N+])CC2(=CNC1(=C(C=CC=C1)2)) * inchi key: ** InChIKey...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5523 PWY-5523] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5523 PWY-5523] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 5,6-dimethylbenzimidazole biosynthesis I (aerobic) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** DMB biosynthesis I |
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''3''' reactions in the full pathway |
| − | + | * [[RIBOFLAVINKIN-RXN]] | |
| − | == Reaction(s) | + | ** 3 associated gene(s): |
| + | *** [[Tiso_gene_7479]] | ||
| + | *** [[Tiso_gene_16837]] | ||
| + | *** [[Tiso_gene_1086]] | ||
| + | ** 4 reconstruction source(s) associated: | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-synechocystis]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=FMNREDUCT-RXN FMNREDUCT-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8771 RXN-8771] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=5,6-dimethylbenzimidazole biosynthesis I (aerobic)}} | |
| − | + | {{#set: common name=DMB biosynthesis I}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=3}} | |
| − | + | {{#set: completion rate=33.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:09, 21 March 2018
Pathway PWY-5523
- taxonomic range:
- common name:
- 5,6-dimethylbenzimidazole biosynthesis I (aerobic)
- Synonym(s):
- DMB biosynthesis I
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- RIBOFLAVINKIN-RXN
- 3 associated gene(s):
- 4 reconstruction source(s) associated:
