Difference between revisions of "TRNA-Arg-inosine34"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-AMINO-4-DEOXYCHORISMATE 4-AMINO-4-DEOXYCHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C([N+])C...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Arg-inosine34 tRNA-Arg-inosine34] == * common name: ** an inosine34 in [tRNAArg2] * Synony...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-AMINO-4-DEOXYCHORISMATE 4-AMINO-4-DEOXYCHORISMATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Arg-inosine34 tRNA-Arg-inosine34] ==
* smiles:
+
** C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1)
+
* inchi key:
+
** InChIKey=OIUJHGOLFKDBSU-HTQZYQBOSA-M
+
 
* common name:
 
* common name:
** 4-amino-4-deoxychorismate
+
** an inosine34 in [tRNAArg2]
* molecular weight:
+
** 224.193   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** [tRNAArg2]-inosine34
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN0-1081]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[ADCLY-RXN]]
 
* [[PABASYN-RXN]]
 
 
== External links  ==
 
== External links  ==
* CAS : 97279-79-3
+
{{#set: common name=an inosine34 in [tRNAArg2]}}
* PUBCHEM:
+
{{#set: common name=[tRNAArg2]-inosine34}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266632 45266632]
+
{{#set: produced by=RXN0-1081}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58406 58406]
+
* BIGG : 4adcho
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C11355 C11355]
+
{{#set: smiles=C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1)}}
+
{{#set: inchi key=InChIKey=OIUJHGOLFKDBSU-HTQZYQBOSA-M}}
+
{{#set: common name=4-amino-4-deoxychorismate}}
+
{{#set: molecular weight=224.193    }}
+
{{#set: consumed or produced by=ADCLY-RXN|PABASYN-RXN}}
+

Latest revision as of 19:12, 21 March 2018

Metabolite tRNA-Arg-inosine34

  • common name:
    • an inosine34 in [tRNAArg2]
  • Synonym(s):
    • [tRNAArg2]-inosine34

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an inosine34 in [tRNAArg2" cannot be used as a page name in this wiki.
"tRNAArg2]-inosine34" cannot be used as a page name in this wiki.