Difference between revisions of "PWY-6823"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFO-CYSTEINE SULFO-CYSTEINE] == * smiles: ** C(C([N+])C(=O)[O-])SS([O-])(=O)=O * inchi key: *...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6823 PWY-6823] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFO-CYSTEINE SULFO-CYSTEINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6823 PWY-6823] ==
−
* smiles:
+
* taxonomic range:
−
** C(C([N+])C(=O)[O-])SS([O-])(=O)=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
** InChIKey=NOKPBJYHPHHWAN-REOHCLBHSA-M
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
 
* common name:
 
* common name:
−
** S-sulfo-L-cysteine
+
** molybdenum cofactor biosynthesis
−
* molecular weight:
+
−
** 200.204   
+
 
* Synonym(s):
 
* Synonym(s):
−
** S-sulfocysteine
+
** moco biosynthesis
 +
** molybdopterin biosynthesis
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''8''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[RXN-8340]]
−
* [[SULFOCYS-RXN]]
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_7986]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-8348]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_17329]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN0-308]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_4284]]
 +
*** [[Tiso_gene_11478]]
 +
*** [[Tiso_gene_14710]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11361 RXN-11361]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12473 RXN-12473]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17809 RXN-17809]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8342 RXN-8342]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8344 RXN-8344]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ECOCYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203408 25203408]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6823 PWY-6823]
−
* CHEBI:
+
{{#set: taxonomic range=TAX-2157}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62225 62225]
+
{{#set: taxonomic range=TAX-2}}
−
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-2759}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05824 C05824]
+
{{#set: common name=molybdenum cofactor biosynthesis}}
−
* HMDB : HMDB00731
+
{{#set: common name=moco biosynthesis|molybdopterin biosynthesis}}
−
{{#set: smiles=C(C([N+])C(=O)[O-])SS([O-])(=O)=O}}
+
{{#set: reaction found=3}}
−
{{#set: inchi key=InChIKey=NOKPBJYHPHHWAN-REOHCLBHSA-M}}
+
{{#set: total reaction=8}}
−
{{#set: common name=S-sulfo-L-cysteine}}
+
{{#set: completion rate=38.0}}
−
{{#set: molecular weight=200.204    }}
+
−
{{#set: common name=S-sulfocysteine}}
+
−
{{#set: consumed or produced by=SULFOCYS-RXN}}
+

Latest revision as of 19:13, 21 March 2018

Pathway PWY-6823

  • taxonomic range:
  • common name:
    • molybdenum cofactor biosynthesis
  • Synonym(s):
    • moco biosynthesis
    • molybdopterin biosynthesis

Reaction(s) found

3 reactions found over 8 reactions in the full pathway

Reaction(s) not found

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-6823&oldid=40303"