Difference between revisions of "CPD-7033"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11404 CPD-11404] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2)) * in...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7033 CPD-7033] == * smiles: ** CCC(CO)C * common name: ** 2-methylbutanol * inchi key: ** I...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7033 CPD-7033] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCC(CO)C |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 2-methylbutanol |
| + | * inchi key: | ||
| + | ** InChIKey=QPRQEDXDYOZYLA-UHFFFAOYSA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 88.149 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** active amyl alcohol |
| − | ** | + | ** 2-methyl-n-butanol |
| − | ** | + | ** 2-methylbutyl alcohol |
| − | ** | + | ** sec-butylcarbinol |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-7694]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=8723 8723] |
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.8398.html 8398] |
| − | {{#set: smiles= | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=48945 48945] |
| − | {{#set: | + | * HMDB : HMDB31527 |
| − | {{#set: molecular weight= | + | {{#set: smiles=CCC(CO)C}} |
| − | {{#set: common name= | + | {{#set: common name=2-methylbutanol}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=QPRQEDXDYOZYLA-UHFFFAOYSA-N}} |
| + | {{#set: molecular weight=88.149 }} | ||
| + | {{#set: common name=active amyl alcohol|2-methyl-n-butanol|2-methylbutyl alcohol|sec-butylcarbinol}} | ||
| + | {{#set: produced by=RXN-7694}} | ||
Latest revision as of 19:14, 21 March 2018
Contents
Metabolite CPD-7033
- smiles:
- CCC(CO)C
- common name:
- 2-methylbutanol
- inchi key:
- InChIKey=QPRQEDXDYOZYLA-UHFFFAOYSA-N
- molecular weight:
- 88.149
- Synonym(s):
- active amyl alcohol
- 2-methyl-n-butanol
- 2-methylbutyl alcohol
- sec-butylcarbinol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
